N1,N2-Dicyclohexylethane-1,2-diamine

Catalog Number	ACM4013983-1
CAS	4013-98-3
Structure
Synonyms	N,N'-dicyclohexylethane-1,2-diamine; N,N'-dicyclohexylethylenediamine
IUPAC Name	N,N'-dicyclohexylethane-1,2-diamine
Molecular Weight	224.39
Molecular Formula	C14H28N2
Canonical SMILES	C1CCC(CC1)NCCNC2CCCCC2
InChI	JMRWVHXGVONXEZ-UHFFFAOYSA-N
InChI Key	InChI=1S/C14H28N2/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h13-16H,1-12H2
Boiling Point	312 °C-lit.
Melting Point	95 °C
Purity	98%
Exact Mass	224.225248902
Heavy Atom Count	16
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Monoisotopic Mass	224.225248902
Rotatable Bond Count	5
Topological Polar Surface Area	24.1 Ų

Q&A

What is the chemical formula of N,N'-Dicyclohexyl-1,2-ethanediamine Hydrate?

The chemical formula is C14H28N2.

What is the molecular weight of N,N'-Dicyclohexyl-1,2-ethanediamine Hydrate?

The molecular weight is 224.39 g/mol.

What is the melting point of N,N'-Dicyclohexyl-1,2-ethanediamine Hydrate?

The melting point is 95°C.

What is the density of N,N'-Dicyclohexyl-1,2-ethanediamine Hydrate?

The density is 0.93±0.1 g/cm3.

In what form does N,N'-Dicyclohexyl-1,2-ethanediamine Hydrate exist?

It exists in powder to crystal form.

What is the color of N,N'-Dicyclohexyl-1,2-ethanediamine Hydrate?

The color is white to almost white.

What is the boiling point of N,N'-Dicyclohexyl-1,2-ethanediamine Hydrate?

The boiling point is 312°C.

In what solvent is N,N'-Dicyclohexyl-1,2-ethanediamine Hydrate soluble?

It is soluble in methanol.

What is the predicted pka value of N,N'-Dicyclohexyl-1,2-ethanediamine Hydrate?

The predicted pka value is 10.85±0.20.

What is the Hazard Class and Packing Group of N,N'-Dicyclohexyl-1,2-ethanediamine Hydrate?

The Hazard Class is 8 and the Packing Group is II.