N1,N2-Dibenzylethane-1,2-diamine

Catalog Number	ACM140283-1
CAS	140-28-3
Structure
Synonyms	DBED; N,N'-Dibenzylethylenediamine
IUPAC Name	N,N'-dibenzylethane-1,2-diamine
Molecular Weight	240.34
Molecular Formula	C16H20N2
InChI	JUHORIMYRDESRB-UHFFFAOYSA-N
InChI Key	InChI=1S/C16H20N2/c1-3-7-15(8-4-1)13-17-11-12-18-14-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2
Boiling Point	373.8 °C at 760 mmHg
Purity	98%
Appearance	Yellow liquid
Isomeric SMILES	C1=CC=C(C=C1)CNCCNCC2=CC=CC=C2

Q&A

What is the molecular weight of N,N'-Bis(phenylmethyl)-1,2-ethanediamine?

The molecular weight of N,N'-Bis(phenylmethyl)-1,2-ethanediamine is 240.34.

What are the product categories that N,N'-Bis(phenylmethyl)-1,2-ethanediamine falls under?

N,N'-Bis(phenylmethyl)-1,2-ethanediamine falls under Nitrogen Compounds, Organic Building Blocks, and Polyamines.

What is the melting point of N,N'-Bis(phenylmethyl)-1,2-ethanediamine?

The melting point of N,N'-Bis(phenylmethyl)-1,2-ethanediamine is 23-25°C.

What are the synonyms for N,N'-Bis(phenylmethyl)-1,2-ethanediamine?

The synonyms for N,N'-Bis(phenylmethyl)-1,2-ethanediamine include N,N'-DIBENZYLETHYLENEDIAMINE, N'N-DIBENZYL-ETHYLENEDIAMINE, 1,2-di(benzylamino)ethane, and others.

Is N,N'-Bis(phenylmethyl)-1,2-ethanediamine soluble in water?

N,N'-Bis(phenylmethyl)-1,2-ethanediamine is slightly soluble in water.

What is the boiling point of N,N'-Bis(phenylmethyl)-1,2-ethanediamine?

The boiling point of N,N'-Bis(phenylmethyl)-1,2-ethanediamine is 195°C at 4 mm Hg.

What is the hazard class of N,N'-Bis(phenylmethyl)-1,2-ethanediamine?

The hazard class of N,N'-Bis(phenylmethyl)-1,2-ethanediamine is class 8.

What is the toxicity of N,N'-Bis(phenylmethyl)-1,2-ethanediamine in oral administration to mice?

The LD50 for oral administration to mice is 388 mg/kg.

What is a potential use of N,N'-Bis(phenylmethyl)-1,2-ethanediamine?

N,N'-Bis(phenylmethyl)-1,2-ethanediamine is an intermediate of cephalosporin and penicillin.

How can N,N'-Bis(phenylmethyl)-1,2-ethanediamine be purified?

N,N'-Bis(phenylmethyl)-1,2-ethanediamine can be purified by dissolving it in acid, extracting with toluene, basifying, extracting with Et2O, drying over solid KOH, and evaporating and fractionating in vacuo.