N1,N1,N4-Trimethylbutane-1,4-diamine

Catalog Number	ACM20383237
CAS	20383-23-7
Synonyms	N,N,N'-Trimethyl-1,4-diaminobutane
IUPAC Name	N,N',N'-trimethylbutane-1,4-diamine
Molecular Weight	130.23
Molecular Formula	C7H18N2
InChI	UOTKNWSJLVKOJR-UHFFFAOYSA-N
InChI Key	InChI=1S/C7H18N2/c1-8-6-4-5-7-9(2)3/h8H,4-7H2,1-3H3
Boiling Point	165.3±8.0 °C at 760 mmHg
Purity	98%
Isomeric SMILES	CNCCCCN(C)C

Q&A

What is the CAS number of N,N,N'-Trimethyl-1,4-diaminobutane?

The CAS number of N,N,N'-Trimethyl-1,4-diaminobutane is 20383-23-7.

What is the molecular weight of N,N,N'-Trimethyl-1,4-diaminobutane?

The molecular weight of N,N,N'-Trimethyl-1,4-diaminobutane is 130.23.

What are the synonyms for N,N,N'-Trimethyl-1,4-diaminobutane?

The synonyms for N,N,N'-Trimethyl-1,4-diaminobutane are N1,N1,N4-TRIMETHYLBUTANE-1,4-DIAMINE; 4-(dimethylamino)butyl](methyl)amine; 1,4-Butanediamine, N1,N1,N4-trimethyl-.

What is the molecular formula of N,N,N'-Trimethyl-1,4-diaminobutane?

The molecular formula of N,N,N'-Trimethyl-1,4-diaminobutane is C7H18N2.

What is the boiling point of N,N,N'-Trimethyl-1,4-diaminobutane?

The boiling point of N,N,N'-Trimethyl-1,4-diaminobutane is 165.3±8.0℃ (760 Torr).

What is the flash point of N,N,N'-Trimethyl-1,4-diaminobutane?

The flash point of N,N,N'-Trimethyl-1,4-diaminobutane is 42.4±9.4℃.

What is the density of N,N,N'-Trimethyl-1,4-diaminobutane at 20 ºC and 760 Torr?

The density of N,N,N'-Trimethyl-1,4-diaminobutane is 0.813±0.06 g/cm3 at 20 ºC and 760 Torr.

What is the pka value of N,N,N'-Trimethyl-1,4-diaminobutane in the predicted range?

The pka value of N,N,N'-Trimethyl-1,4-diaminobutane is predicted to be 10.67±0.10.

How many nitrogen atoms are present in the molecular formula of N,N,N'-Trimethyl-1,4-diaminobutane?

There are two nitrogen atoms present in the molecular formula of N,N,N'-Trimethyl-1,4-diaminobutane.

What is the longest synonym listed for N,N,N'-Trimethyl-1,4-diaminobutane?

The longest synonym listed for N,N,N'-Trimethyl-1,4-diaminobutane is 1,4-Butanediamine, N1,N1,N4-trimethyl-.