N1,N1,N4,N4-Tetramethylbutane-1,4-diamine

Catalog Number	ACM111513-2
CAS	111-51-3
Structure
Synonyms	Tetramethyldiaminobutane; Tetramethylputrescine
IUPAC Name	N,N,N',N'-tetramethylbutane-1,4-diamine
Molecular Weight	144.26
Molecular Formula	C8H20N2
Canonical SMILES	CN(C)CCCCN(C)C
InChI	VEAZEPMQWHPHAG-UHFFFAOYSA-N
InChI Key	InChI=1S/C8H20N2/c1-9(2)7-5-6-8-10(3)4/h5-8H2,1-4H3
Boiling Point	166-167 °C-lit.
Melting Point	-100 °C
Purity	98%
Appearance	Colorless liquid
EC Number	203-878-5
Exact Mass	144.162648646
Heavy Atom Count	10
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	144.162648646
Rotatable Bond Count	5
Topological Polar Surface Area	6.5 Ų

Q&A

What is the IUPAC name of N1,N1,N4,N4-Tetramethylbutane-1,4-diamine?

The IUPAC name of N1,N1,N4,N4-Tetramethylbutane-1,4-diamine is N,N,N',N'-Tetramethyl-1,4-butanediamine.

What are some synonyms of N1,N1,N4,N4-Tetramethylbutane-1,4-diamine?

Some synonyms of N1,N1,N4,N4-Tetramethylbutane-1,4-diamine are TETRAMETHYLDIAMINOBUTANE, N,N,N',N'-Tetramethyl-1,4-diaminobutane, and N,N,N',N'-TETRAMETHYLPUTRESCINE.

What is the molecular formula of N1,N1,N4,N4-Tetramethylbutane-1,4-diamine?

The molecular formula of N1,N1,N4,N4-Tetramethylbutane-1,4-diamine is C8H20N2.

What is the melting point of N1,N1,N4,N4-Tetramethylbutane-1,4-diamine?

The melting point of N1,N1,N4,N4-Tetramethylbutane-1,4-diamine is -100 °C.

What is the density of N1,N1,N4,N4-Tetramethylbutane-1,4-diamine at 25 °C?

The density of N1,N1,N4,N4-Tetramethylbutane-1,4-diamine at 25 °C is 0.792 g/mL.

What is the boiling point of N1,N1,N4,N4-Tetramethylbutane-1,4-diamine?

The boiling point of N1,N1,N4,N4-Tetramethylbutane-1,4-diamine is 166-167 °C.

How should N1,N1,N4,N4-Tetramethylbutane-1,4-diamine be stored?

The compound should be stored below +30°C.

What is the Hazard Class of N1,N1,N4,N4-Tetramethylbutane-1,4-diamine?

The Hazard Class of N1,N1,N4,N4-Tetramethylbutane-1,4-diamine is 8.

What are the Safety Statements associated with N1,N1,N4,N4-Tetramethylbutane-1,4-diamine?

The Safety Statements associated with N1,N1,N4,N4-Tetramethylbutane-1,4-diamine are 26-36/37/39-45.

What is the HS Code of N1,N1,N4,N4-Tetramethylbutane-1,4-diamine?

The HS Code of N1,N1,N4,N4-Tetramethylbutane-1,4-diamine is 29212900.