ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

N1,N1-Bis(3-(Dimethylamino)propyl)-N3,N3-dimethylpropane-1,3-diamine

Catalog Number ACM33329350
CAS 33329-35-0
Structure {[CurrentData.Name]}
Synonyms Tris-(3-dimethylamino)-propylamine
IUPAC Name N',N'-bis[3-(dimethylamino)propyl]-N,N-dimethylpropane-1,3-diamine
Molecular Weight 272.47
Molecular Formula C15H36N4
InChI DTKANQSCBACEPK-UHFFFAOYSA-N
InChI Key InChI=1S/C15H36N4/c1-16(2)10-7-13-19(14-8-11-17(3)4)15-9-12-18(5)6/h7-15H2,1-6H3
Boiling Point 297.7 °C at 760 mmHg
Purity 98%
Appearance Colorless liquid
Isomeric SMILES CN(C)CCCN(CCCN(C)C)CCCN(C)C
Q&A

What is the chemical formula for N,N-bis[3-(dimethylamino)propyl]-N',N'-dimethylpropane-1,3-diamine?

The chemical formula is C15H36N4.

What is the molecular weight of N,N-bis[3-(dimethylamino)propyl]-N',N'-dimethylpropane-1,3-diamine?

The molecular weight is 272.47 g/mol.

What is the boiling point of N,N-bis[3-(dimethylamino)propyl]-N',N'-dimethylpropane-1,3-diamine?

The predicted boiling point is 297.7±8.0 °C.

What is the color of N,N-bis[3-(dimethylamino)propyl]-N',N'-dimethylpropane-1,3-diamine?

The color is colorless.

What is the water solubility of N,N-bis[3-(dimethylamino)propyl]-N',N'-dimethylpropane-1,3-diamine?

The water solubility is 54.99 g/L at 25°C.

What is the pKa value of N,N-bis[3-(dimethylamino)propyl]-N',N'-dimethylpropane-1,3-diamine?

The predicted pKa value is 10.05±0.28.

What is the storage temperature recommended for N,N-bis[3-(dimethylamino)propyl]-N',N'-dimethylpropane-1,3-diamine?

The recommended storage temperature is 2-8°C.

Is N,N-bis[3-(dimethylamino)propyl]-N',N'-dimethylpropane-1,3-diamine flammable?

No, it is non-flammable.

What are some synonyms for N,N-bis[3-(dimethylamino)propyl]-N',N'-dimethylpropane-1,3-diamine?

Some synonyms are Tris-(dimethylaminopropyl)amine, Polycat 9, RC-9, etc.

What are some product categories that N,N-bis[3-(dimethylamino)propyl]-N',N'-dimethylpropane-1,3-diamine falls under?

It falls under the category of Organics.

Please kindly note that our products and services are for research use only.