N1,N1,2-Trimethylpropane-1,3-diamine

Catalog Number	ACM6105722-1
CAS	6105-72-2
Structure
Synonyms	(3-Amino-2-methylpropyl)dimethylamine
IUPAC Name	N',N',2-trimethylpropane-1,3-diamine
Molecular Weight	116.21
Molecular Formula	C6H16N2
InChI	DAMJSIMZZSEQRD-UHFFFAOYSA-N
InChI Key	InChI=1S/C6H16N2/c1-6(4-7)5-8(2)3/h6H,4-5,7H2,1-3H3
Purity	98%
Appearance	Liquid
Isomeric SMILES	CC(CN)CN(C)C

Q&A

What is the CAS number for N,N,2-trimethylpropane-1,3-diamine?

The CAS number for N,N,2-trimethylpropane-1,3-diamine is 6105-72-2.

What is the molecular weight of N,N,2-trimethylpropane-1,3-diamine?

The molecular weight of N,N,2-trimethylpropane-1,3-diamine is 116.2.

What are some synonyms for N,N,2-trimethylpropane-1,3-diamine?

Some synonyms for N,N,2-trimethylpropane-1,3-diamine are (3-amino-2-methylpropyl)dimethylamine, (3-amino-2-methylpropyl)dimethylamine(SALTDATA: FREE), 1,3-Propanediamine, N1,N1,2-trimethyl-, N1,N1,2-Trimethylpropane-1,3-diamine.

What is the molecular formula of N,N,2-trimethylpropane-1,3-diamine?

The molecular formula of N,N,2-trimethylpropane-1,3-diamine is C6H16N2.

What is the EINECS number of N,N,2-trimethylpropane-1,3-diamine?

The EINECS number of N,N,2-trimethylpropane-1,3-diamine is 228-061-0.

What are the hazard codes associated with N,N,2-trimethylpropane-1,3-diamine?

The hazard codes associated with N,N,2-trimethylpropane-1,3-diamine are C.

What are the safety statements related to N,N,2-trimethylpropane-1,3-diamine?

The safety statements related to N,N,2-trimethylpropane-1,3-diamine are 26-36/37/39-45.

What is the WGK (Water Hazard Class) of N,N,2-trimethylpropane-1,3-diamine in Germany?

The WGK of N,N,2-trimethylpropane-1,3-diamine in Germany is 3.

What are the risk statements associated with N,N,2-trimethylpropane-1,3-diamine?

The risk statements associated with N,N,2-trimethylpropane-1,3-diamine are 21/22-34-43.

What is the RIDADR (Risk of Transported Chemicals) classification for N,N,2-trimethylpropane-1,3-diamine?

The RIDADR classification for N,N,2-trimethylpropane-1,3-diamine is UN 2735PSN1 8 / PGII.