N-Propyldiphenylphosphine

Catalog Number	ACM7650842-1
CAS	7650-84-2
Structure
Synonyms	Diphenyl-N-Propylphosphine; Diphenylpropyl-Phosphin
IUPAC Name	diphenyl(propyl)phosphane
Molecular Weight	228.27
Molecular Formula	C15H17P
InChI	AAXGWYDSLJUQLN-UHFFFAOYSA-N
InChI Key	InChI=1S/C15H17P/c1-2-13-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3
Boiling Point	163-164 °C at 14 mmHg
Flash Point	>110 °C
Purity	98%
Density	1.008 g/cm3
Appearance	Liquid
Isomeric SMILES	CCCP(C1=CC=CC=C1)C2=CC=CC=C2

Q&A

What is the Chemical Structure of N-Propyldiphenylphosphine?

The Chemical Structure of N-Propyldiphenylphosphine is CCCP(C1=CC=CC=C1)C2=CC=CC=C2.

What is the Canonical SMILES of N-Propyldiphenylphosphine?

The Canonical SMILES of N-Propyldiphenylphosphine is CCCP(C1=CC=CC=C1)C2=CC=CC=C2.

What is the IUPAC Name of N-Propyldiphenylphosphine?

The IUPAC Name of N-Propyldiphenylphosphine is diphenyl(propyl)phosphane.

What is the Molecular Formula of N-Propyldiphenylphosphine?

The Molecular Formula of N-Propyldiphenylphosphine is C15H17P.

What is the Molecular Weight of N-Propyldiphenylphosphine?

The Molecular Weight of N-Propyldiphenylphosphine is 228.27g/mol.

How many Covalently-Bonded Units does N-Propyldiphenylphosphine have?

N-Propyldiphenylphosphine has 1 Covalently-Bonded Unit.

What is the XLogP3 value of N-Propyldiphenylphosphine?

The XLogP3 value of N-Propyldiphenylphosphine is 3.9.

What are some Depositor-Supplied Synonyms for N-Propyldiphenylphosphine?

Some Depositor-Supplied Synonyms for N-Propyldiphenylphosphine are Diphenylpropylphosphine, Propyldiphenylphosphine, and Diphenyl-n-propylphosphine.

What is the CAS number of N-Propyldiphenylphosphine?

The CAS number of N-Propyldiphenylphosphine is 7650-84-2.

What is the InChIKey of N-Propyldiphenylphosphine?

The InChIKey of N-Propyldiphenylphosphine is AAXGWYDSLJUQLN-UHFFFAOYSA-N.