ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry

N-Phenyl-2-(di-t-butylphosphino)indol

Catalog Number ACM740815376-1
CAS 740815-37-6
Structure N-Phenyl-2-(di-t-butylphosphino)indol
Synonyms 2-(Di-Tert-Butylphosphino)-1-Phenylindole; N-Phenylindol-2-yl-di-tert-butylphosphine; cataCXium PIntB
IUPAC Name ditert-butyl-(1-phenylindol-2-yl)phosphane
Molecular Weight 337.44
Molecular Formula C22H28NP
InChI HDZRDZCQFYUOHE-UHFFFAOYSA-N
InChI Key InChI=1S/C22H28NP/c1-21(2,3)24(22(4,5)6)20-16-17-12-10-11-15-19(17)23(20)18-13-8-7-9-14-18/h7-16H,1-6H3
Boiling Point 455.4±27.0 °C(Predicted)
Melting Point 90-92 °C
Purity 98%
Appearance Solid
Isomeric SMILES CC(C)(C)P(C1=CC2=CC=CC=C2N1C3=CC=CC=C3)C(C)(C)C
Type cataCXium
Q&A

What is the CAS number of N-Phenyl-2-(di-t-butylphosphino)indol?

The CAS number is 740815-37-6.

What is the molecular formula of N-Phenyl-2-(di-t-butylphosphino)indol?

The molecular formula is C22H28NP.

What is the molecular weight of N-Phenyl-2-(di-t-butylphosphino)indol?

The molecular weight is 337.4 g/mol.

Can you provide the Canonical SMILES representation of N-Phenyl-2-(di-t-butylphosphino)indol?

The Canonical SMILES is CC(C)(C)P(C1=CC2=CC=CC=C2N1C3=CC=CC=C3)C(C)(C)C.

How many heavy atoms are present in N-Phenyl-2-(di-t-butylphosphino)indol?

There are 24 heavy atoms in N-Phenyl-2-(di-t-butylphosphino)indol.

What is the exact mass of N-Phenyl-2-(di-t-butylphosphino)indol?

The exact mass is 337.195936895.

How many rotatable bonds are present in N-Phenyl-2-(di-t-butylphosphino)indol?

There are 4 rotatable bonds in N-Phenyl-2-(di-t-butylphosphino)indol.

What is the InChIKey of N-Phenyl-2-(di-t-butylphosphino)indol?

The InChIKey is HDZRDZCQFYUOHE-UHFFFAOYSA-N.

What are some other names or synonyms for N-Phenyl-2-(di-t-butylphosphino)indol provided by the depositor?

Some other names or synonyms are 2-(Di-tert-butylphosphino)-1-phenylindole, N-Phenyl-2-(di-tert-butylphosphino)indole, and ditert-butyl-(1-phenylindol-2-yl)phosphane.

Please kindly note that our products and services are for research use only.