What is the CAS number of N-Phenyl-2-(di-t-butylphosphino)indol?
The CAS number is 740815-37-6.
What is the molecular formula of N-Phenyl-2-(di-t-butylphosphino)indol?
The molecular formula is C22H28NP.
What is the molecular weight of N-Phenyl-2-(di-t-butylphosphino)indol?
The molecular weight is 337.4 g/mol.
Can you provide the Canonical SMILES representation of N-Phenyl-2-(di-t-butylphosphino)indol?
The Canonical SMILES is CC(C)(C)P(C1=CC2=CC=CC=C2N1C3=CC=CC=C3)C(C)(C)C.
How many heavy atoms are present in N-Phenyl-2-(di-t-butylphosphino)indol?
There are 24 heavy atoms in N-Phenyl-2-(di-t-butylphosphino)indol.
What is the exact mass of N-Phenyl-2-(di-t-butylphosphino)indol?
The exact mass is 337.195936895.
How many rotatable bonds are present in N-Phenyl-2-(di-t-butylphosphino)indol?
There are 4 rotatable bonds in N-Phenyl-2-(di-t-butylphosphino)indol.
What is the InChIKey of N-Phenyl-2-(di-t-butylphosphino)indol?
The InChIKey is HDZRDZCQFYUOHE-UHFFFAOYSA-N.
What are some other names or synonyms for N-Phenyl-2-(di-t-butylphosphino)indol provided by the depositor?
Some other names or synonyms are 2-(Di-tert-butylphosphino)-1-phenylindole, N-Phenyl-2-(di-tert-butylphosphino)indole, and ditert-butyl-(1-phenylindol-2-yl)phosphane.