N,N'-Diphenylbenzidine

Catalog Number	ACM531919-2
CAS	531-91-9
Structure
Synonyms	Diphenylbenzidine; 4,4'-Dianilinobiphenyl
IUPAC Name	4-(4-anilinophenyl)-N-phenylaniline
Molecular Weight	336.43
Molecular Formula	C24H20N2
Canonical SMILES	C1=CC=C(C=C1)NC2=CC=C(C=C2)C3=CC=C(C=C3)NC4=CC=CC=C4
InChI	FDRNXKXKFNHNCA-UHFFFAOYSA-N
InChI Key	InChI=1S/C24H20N2/c1-3-7-21(8-4-1)25-23-15-11-19(12-16-23)20-13-17-24(18-14-20)26-22-9-5-2-6-10-22/h1-18,25-26H
Melting Point	246-248 °C-lit.
Purity	98%
Appearance	Beige powder
Complexity	343
Covalently-Bonded Unit Count	1
EC Number	208-521-7
Exact Mass	336.162649g/mol
Formal Charge	0
Heavy Atom Count	26
Isomeric SMILES	C1=CC=C(C=C1)NC2=CC=C(C=C2)C3=CC=C(C=C3)NC4=CC=CC=C4
Monoisotopic Mass	336.162649g/mol
Rotatable Bond Count	5

Q&A

What is the CAS number of N,N'-Diphenylbenzidine?

The CAS number of N,N'-Diphenylbenzidine is 531-91-9.

What is the molecular weight of N,N'-Diphenylbenzidine?

The molecular weight of N,N'-Diphenylbenzidine is 336.43.

What are some product categories that N,N'-Diphenylbenzidine falls under?

N,N'-Diphenylbenzidine falls under categories such as C20 to C30+, Analytical Reagents, Organic Building Blocks, and Aromatic Phenylacetic Acids and Derivatives.

What is the melting point of N,N'-Diphenylbenzidine?

The melting point of N,N'-Diphenylbenzidine is 246-248°C.

How should N,N'-Diphenylbenzidine be stored?

N,N'-Diphenylbenzidine should be stored below +30°C.

Can N,N'-Diphenylbenzidine be dissolved in water?

N,N'-Diphenylbenzidine is insoluble in water.

What are some synonyms for N,N'-Diphenylbenzidine?

Some synonyms for N,N'-Diphenylbenzidine are N,N'-DIPHENYLBENZIDINE, N,N'-DIPHENYL BIPHENYLAMINE, and N'-Diphenylbenzidine.

What safety statements are associated with N,N'-Diphenylbenzidine?

The safety statements associated with N,N'-Diphenylbenzidine are 22-24/25.

What is the hazard class of N,N'-Diphenylbenzidine?

The hazard class of N,N'-Diphenylbenzidine is 6.1(b).

What are some uses of N,N'-Diphenylbenzidine?

N,N'-Diphenylbenzidine is used as an indicator for redox titrations and as an intermediate in organic synthesis.