ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

N,N'-Bis(2,6-diisopropylphenyl)ethanediimine

Catalog Number ACM74663755-1
CAS 74663-75-5
Synonyms (1E,2E)-1,2-Bis(2,6-Diisopropylphenylimino)ethane; Glyoxal bis(2,6-diisopropylanil)
IUPAC Name N,N'-bis[2,6-di(propan-2-yl)phenyl]ethane-1,2-diimine
Molecular Weight 376.58
Molecular Formula C26H36N2
InChI JWVIIGXMTONOFR-UHFFFAOYSA-N
InChI Key InChI=1S/C26H36N2/c1-17(2)21-11-9-12-22(18(3)4)25(21)27-15-16-28-26-23(19(5)6)13-10-14-24(26)20(7)8/h9-20H,1-8H3
Melting Point 105-109 °C
Purity 98%
Appearance Solid
Isomeric SMILES CC(C)C1=C(C(=CC=C1)C(C)C)N=CC=NC2=C(C=CC=C2C(C)C)C(C)C
Q&A

What is the chemical formula of N,N'-Bis(2,6-diisopropylphenyl)ethanediimine?

The chemical formula is C26H36N2.

What is the molecular weight of N,N'-Bis(2,6-diisopropylphenyl)ethanediimine?

The molecular weight is 376.58.

What is the melting point of N,N'-Bis(2,6-diisopropylphenyl)ethanediimine?

The melting point is 105-109 °C.

What is the density of N,N'-Bis(2,6-diisopropylphenyl)ethanediimine?

The density is 0.95.

What is the predicted boiling point of N,N'-Bis(2,6-diisopropylphenyl)ethanediimine?

The predicted boiling point is 492.0±55.0 °C.

What is the predicted pka value of N,N'-Bis(2,6-diisopropylphenyl)ethanediimine?

The predicted pka value is 1.85±0.50.

What are some synonyms for N,N'-Bis(2,6-diisopropylphenyl)ethanediimine?

Some synonyms include N,N'-1,2-Ethanediylidenebis[2,6-bis(1-methylethyl)phenylamine] and N,N'-Bis(2,6-diisopropylphenyl)glyoxaldiimine.

What are the uses of N,N'-Bis(2,6-diisopropylphenyl)ethanediimine?

It is used as a reactant in the preparation of derived ruthenium olefin metathesis catalysts, as an N-cyclic carbene ligand, and as a catalyst in various reactions such as palladium-catalyzed aerobic alcohol oxidation.

How is N,N'-Bis(2,6-diisopropylphenyl)ethanediimine utilized in regioselective alkylation reactions?

It is used in regioselective alkylation in the presence of ruthenium-bisimine catalytic precursors.

What kind of complexes can be prepared using N,N'-Bis(2,6-diisopropylphenyl)ethanediimine as a catalyst?

It can be used for the preparation of ruthenium nitrosyl alpha-diimine and iminoketone complexes for catalyzing transfer hydrogenation of ketones and atom transfer radical polymerization reactions.

Please kindly note that our products and services are for research use only.