N,N'-((1S,2S)-Cyclohexane-1,2-diyl)bis(4-methylbenzenesulfonamide)

Catalog Number	ACM212555287-1
CAS	212555-28-7
Structure
Synonyms	(1S,2S)-(−)-N,N'-Di-p-tosyl-1,2-cyclohexanediamine
IUPAC Name	4-methyl-N-[(1S,2S)-2-[(4-methylphenyl)sulfonylamino]cyclohexyl]benzenesulfonamide
Molecular Weight	422.56
Molecular Formula	C20H26N2O4S2
InChI	FIAAGQKYVFEMGC-PMACEKPBSA-N
InChI Key	InChI=1S/C20H26N2O4S2/c1-15-7-11-17(12-8-15)27(23,24)21-19-5-3-4-6-20(19)22-28(25,26)18-13-9-16(2)10-14-18/h7-14,19-22H,3-6H2,1-2H3/t19-,20-/m0/s1
Melting Point	170-173 °C
Purity	98%
Appearance	White powder
Isomeric SMILES	CC1=CC=C(C=C1)S(=O)(=O)N[C@H]2CCCC[C@@H]2NS(=O)(=O)C3=CC=C(C=C3)C

Q&A

What is the molecular weight of the compound with CAS number 212555-28-7?

The molecular weight is 422.56.

What are the product categories that this compound falls under?

Hydrogenation Chiral Building Blocks, Asymmetric Synthesis, Chiral Catalysts, Ligands, and Reagents, Organic Building Blocks, Polyamines.

What is the specific product name of this compound?

(1S,2S)-(-)-N,N-DI-P-TOSYL-1,2-CYCLOHEXANEDIAMINE.

What are some synonyms for this compound?

(1S,2S)-1,2-N,N'-BIS((4-TOLUENESULFONYL)AMINO)-CYCLOHEXANE, N,N'-(1S,2S)-Cyclohexane-1,2-diyl)bis(4-methylbenzenesulfonamide), among others.

What is the molecular formula of this compound?

The molecular formula is C20H26N2O4S2.

What is the melting point of this compound?

The melting point is 170-173 °C.

What is the predicted density of this compound?

The predicted density is 1.33±0.1 g/cm3.

What is the predicted pKa value of this compound?

The predicted pKa value is 11.02±0.40.

What is the predicted boiling point of this compound?

The predicted boiling point is 591.4±60.0 °C.

How should this compound be stored?

It should be kept in a dark place, in an inert atmosphere, at room temperature.