ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

N,N'-((1R,2R)-Cyclohexane-1,2-diyl)bis(N-hydroxy-3,3,3-triphenylpropanamide)

Catalog Number ACM860036299-1
CAS 860036-29-9
Structure {[CurrentData.Name]}
Synonyms (1R,2R)-N,N'-Dihydroxy-N,N'-Bis(3,3,3-Triphenylpropionyl)Cyclohexane-1,2-Diamine; N-Hydroxy-N-[(1R,2R)-2-[Hydroxy(3,3,3-Triphenylpropanoyl)Amino]Cyclohexyl]-3,3,3-Triphenylpropanamide
IUPAC Name N-hydroxy-N-[(1R,2R)-2-[hydroxy(3,3,3-triphenylpropanoyl)amino]cyclohexyl]-3,3,3-triphenylpropanamide
Molecular Weight 714.89
Molecular Formula C48H46N2O4
InChI VWHFLRGVWVBFFY-NDOUMJCMSA-N
InChI Key InChI=1S/C48H46N2O4/c51-45(35-47(37-21-7-1-8-22-37,38-23-9-2-10-24-38)39-25-11-3-12-26-39)49(53)43-33-19-20-34-44(43)50(54)46(52)36-48(40-27-13-4-14-28-40,41-29-15-5-16-30-41)42-31-17-6-18-32-42/h1-18,21-32,43-44,53-54H,19-20,33-36H2/t43-,44-/m1/s1
Melting Point 237 °C
Purity 98%
Isomeric SMILES C1CC[C@H]([C@@H](C1)N(C(=O)CC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)O)N(C(=O)CC(C5=CC=CC=C5)(C6=CC=CC=C6)C7=CC=CC=C7)O
Q&A

What is the molecular weight of the compound with CAS number 860036-29-9?

The molecular weight of the compound is 714.89.

What is the product name of the compound?

The product name is (1R,2R)-N,N'-Dihydroxy-N,N'-bis(3,3,3-triphenylpropionyl)cyclohexane-1,2-diamine.

What are some synonyms of the compound?

Some synonyms are (1R,2R)-N,N'-Dihydroxy-N,N'-bis(3,3,3-triphenylpropionyl)cyclohexane-1,2-diamine, (1R,2R)-N,N'-Dihydroxy-N,N'-bis(3,3,3-triphenylpropionyl)-1,2-cyclohexanediamine, (R)-CBHA-TPP, and others.

What is the melting point of the compound?

The melting point is 237°C.

How should the compound be stored?

The compound should be stored at 2-8°C.

What is the refractive index of the compound in CHCl3?

The refractive index is 41° (C=1, CHCl3).

What is the chemical formula of the compound?

The chemical formula is C48H46N2O4.

What is the CAS DataBase Reference number of the compound?

The CAS DataBase Reference number is 860036-29-9.

What is the HS Code of the compound?

The HS Code is 29215900.

How is the compound represented in chemical terms?

The compound is represented as N,N'-((1R,2R)-Cyclohexane-1,2-diyl)bis(N-hydroxy-3,3,3-triphenylpropanamide).

Please kindly note that our products and services are for research use only.