N,N'-((1R,2R)-Cyclohexane-1,2-diyl)bis(N-hydroxy-2,2-diphenylacetamide)

Catalog Number	ACM860036164-2
CAS	860036-16-4
Structure
Synonyms	(1R,2R)-N,N'-Dihydroxy-N,N'-Bis(Diphenylacetyl)Cyclohexane-1,2-Diamine; N-[(1R,2R)-2-[(2,2-Diphenylacetyl)-Hydroxyamino]Cyclohexyl]-N-Hydroxy-2,2-Diphenylacetamide
IUPAC Name	N-[(1R,2R)-2-[(2,2-diphenylacetyl)-hydroxyamino]cyclohexyl]-N-hydroxy-2,2-diphenylacetamide
Molecular Weight	534.65
Molecular Formula	C34H34N2O4
InChI	FSKBHXVAXWHEQT-LOYHVIPDSA-N
InChI Key	InChI=1S/C34H34N2O4/c37-33(31(25-15-5-1-6-16-25)26-17-7-2-8-18-26)35(39)29-23-13-14-24-30(29)36(40)34(38)32(27-19-9-3-10-20-27)28-21-11-4-12-22-28/h1-12,15-22,29-32,39-40H,13-14,23-24H2/t29-,30-/m1/s1
Melting Point	200-205 °C
Purity	98%
Appearance	Solid
Isomeric SMILES	C1CC[C@H]([C@@H](C1)N(C(=O)C(C2=CC=CC=C2)C3=CC=CC=C3)O)N(C(=O)C(C4=CC=CC=C4)C5=CC=CC=C5)O

Q&A

What is the molecular weight of the compound N,N'-((1R,2R)-Cyclohexane-1,2-diyl)bis(N-hydroxy-2,2-diphenylacetamide)?

The molecular weight is 534.64.

What are the product categories that the compound belongs to?

The compound belongs to the categories of Asymmetric Synthesis and Synthetic Organic Chemistry.

What is the product name of the compound?

The product name is (1R,2R)-N,N'-Dihydroxy-N,N'-bis(diphenylacetyl)cyclohexane-1,2-diamine.

What is the synonym for the compound N,N'-((1R,2R)-Cyclohexane-1,2-diyl)bis(N-hydroxy-2,2-diphenylacetamide)?

One of the synonyms is BenzeneacetaMide,N,N'-(1R,2R)-1,2-cyclohexanediylbis[N-hydroxy-a-phenyl-.

What is the melting point of the compound?

The melting point is 200-205 °C.

What is the density of the compound?

The density is 1.28±0.1 g/cm3 (Predicted).

In what solvent is the compound soluble?

The compound is soluble in Chloroform.

What is the predicted pKa value of the compound?

The pKa value is predicted to be 8.29±0.40.

What is the predicted boiling point of the compound?

The predicted boiling point is 727.6±70.0 °C.

What is the color of the compound?

The compound is White to Almost white in color.