What is the molecular formula of N,N'-(1,2-Phenylene)bis(2-(diphenylphosphino)benzamide)?
The molecular formula is C44H34N2O2P2.
What is the molecular weight of N,N'-(1,2-Phenylene)bis(2-(diphenylphosphino)benzamide)?
The molecular weight is 684.7g/mol.
What is the Exact Mass of N,N'-(1,2-Phenylene)bis(2-(diphenylphosphino)benzamide)?
The Exact Mass is 684.20955233.
How many hydrogen bond acceptor counts does N,N'-(1,2-Phenylene)bis(2-(diphenylphosphino)benzamide) have?
It has 2 hydrogen bond acceptor counts.
What is the Canonical SMILES representation of N,N'-(1,2-Phenylene)bis(2-(diphenylphosphino)benzamide)?
C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3C(=O)NC4=CC=CC=C4NC(=O)C5=CC=CC=C5P(C6=CC=CC=C6)C7=CC=CC=C7
What is the IUPAC name of N,N'-(1,2-Phenylene)bis(2-(diphenylphosphino)benzamide)?
The IUPAC name is 2-diphenylphosphanyl-N-[2-[(2-diphenylphosphanylbenzoyl)amino]phenyl]benzamide.
How many comuted properties defined atom stereocenter count does N,N'-(1,2-Phenylene)bis(2-(diphenylphosphino)benzamide have?
It has 0 computed properties defined atom stereocenter count.
What is the InChI key of N,N'-(1,2-Phenylene)bis(2-(diphenylphosphino)benzamide)?
The InChI key is GGNHSAPYNLPQEX-UHFFFAOYSA-N.
How many rotatable bond counts does N,N'-(1,2-Phenylene)bis(2-(diphenylphosphino)benzamide have?
It has 10 rotatable bond counts.
What is the CAS number of N,N'-(1,2-Phenylene)bis(2-(diphenylphosphino)benzamide)?
The CAS number is 659727-33-0.