N-MEthyl Mesoporphyrin IX

Catalog Number	ACM142234853-1
CAS	142234-85-3
Synonyms	8,13-Diethyl-3,7,12,17,23-pentamethyl-21H,23H-porphine-2,18-dipropanoic acid
IUPAC Name	3-[18-(2-carboxyethyl)-7,12-diethyl-3,8,13,17,22-pentamethyl-23H-porphyrin-2-yl]propanoic acid
Molecular Weight	580.72
Molecular Formula	C35H40N4O4
InChI	XODZICXILWCPBD-UHFFFAOYSA-N
InChI Key	InChI=1S/C35H40N4O4/c1-8-22-18(3)26-14-27-19(4)24(10-12-34(40)41)29(36-27)15-30-25(11-13-35(42)43)20(5)28(38-30)16-33-23(9-2)21(6)32(39(33)7)17-31(22)37-26/h14-17,37H,8-13H2,1-7H3,(H,40,41)(H,42,43)
Isomeric SMILES	CCC1=C(C2=CC3=NC(=CC4=NC(=CC5=C(C(=C(N5C)C=C1N2)C)CC)C(=C4CCC(=O)O)C)C(=C3C)CCC(=O)O)C

Q&A

What is the chemical structure of N-Methyl Mesoporphyrin IX?

The chemical structure of N-Methyl Mesoporphyrin IX is C35H40N4O4.

What is the molecular weight of N-Methyl Mesoporphyrin IX?

The molecular weight of N-Methyl Mesoporphyrin IX is 580.72.

What are the product categories to which N-Methyl Mesoporphyrin IX belongs?

N-Methyl Mesoporphyrin IX belongs to the product category of Porphyrins.

What is the predicted density of N-Methyl Mesoporphyrin IX?

The predicted density of N-Methyl Mesoporphyrin IX is 1.26±0.1 g/cm3.

In what form does N-Methyl Mesoporphyrin IX exist?

N-Methyl Mesoporphyrin IX exists in the form of a crystalline solid.

What are some synonyms for N-Methyl Mesoporphyrin IX?

Some synonyms for N-Methyl Mesoporphyrin IX include 21H,23H-Porphine-2,18-dipropanoic acid, 8,13-diethyl-3,7,12,17,23-pentamethyl- and 8,13-Diethyl-3,7,12,17,23-pentamethyl-21H,23H-porphine-2,18-dipropanoic acid.

What is the solubility of N-Methyl Mesoporphyrin IX in DMF?

N-Methyl Mesoporphyrin IX is soluble in DMF at 20 mg/ml.

How should N-Methyl Mesoporphyrin IX be stored?

N-Methyl Mesoporphyrin IX should be stored at -20°C.

What is the molecular formula of N-Methyl Mesoporphyrin IX?

The molecular formula of N-Methyl Mesoporphyrin IX is C35H40N4O4.

How is N-Methyl Mesoporphyrin IX soluble in DMSO?

N-Methyl Mesoporphyrin IX is soluble in DMSO at 15 mg/ml.