What is the molecular formula of the compound N-((Dicyclohexylphosphino)(phenyl)methyl)-2,4,6-trimethylaniline?
The molecular formula is C28H40NP.
What is the IUPAC name of the compound N-((Dicyclohexylphosphino)(phenyl)methyl)-2,4,6-trimethylaniline?
The IUPAC name is N-[dicyclohexylphosphanyl(phenyl)methyl]-2,4,6-trimethylaniline.
What is the exact mass of the compound N-((Dicyclohexylphosphino)(phenyl)methyl)-2,4,6-trimethylaniline?
The exact mass is 421.28983728.
How many covalently-bonded units are there in the compound N-((Dicyclohexylphosphino)(phenyl)methyl)-2,4,6-trimethylaniline?
There is 1 covalently-bonded unit.
What is the canonical SMILES representation of the compound N-((Dicyclohexylphosphino)(phenyl)methyl)-2,4,6-trimethylaniline?
CC1=CC(=C(C(=C1)C)NC(C2=CC=CC=C2)P(C3CCCCC3)C4CCCCC4)C
How many hydrogen bond acceptors are present in the compound N-((Dicyclohexylphosphino)(phenyl)methyl)-2,4,6-trimethylaniline?
There is 1 hydrogen bond acceptor.
What is the XLogP3 value of the compound N-((Dicyclohexylphosphino)(phenyl)methyl)-2,4,6-trimethylaniline?
The XLogP3 value is 8.
Is there any isotope atom present in the compound N-((Dicyclohexylphosphino)(phenyl)methyl)-2,4,6-trimethylaniline?
No, there are no isotope atoms present.
What is the topological polar surface area of the compound N-((Dicyclohexylphosphino)(phenyl)methyl)-2,4,6-trimethylaniline?
The topological polar surface area is 12.
What is the depositor-supplied synonym for the compound N-((Dicyclohexylphosphino)(phenyl)methyl)-2,4,6-trimethylaniline?
A depositor-supplied synonym is alpha-(Dicyclohexylphosphino)-N-(2,4,6-trimethylphenyl)benzenemethanamine.