ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

N-decyl triphenylphosphonium bromide

Catalog Number ACM32339438-1
CAS 32339-43-8
Structure {[CurrentData.Name]}
Synonyms Triphenyldecylphosphonium·bromide
IUPAC Name Decyl(triphenyl)phosphanium;bromide
Molecular Weight 483.46
Molecular Formula C28H36BrP
Canonical SMILES CCCCCCCCCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-]
InChI InChI=1S/C28H36P.BrH/c1-2-3-4-5-6-7-8-18-25-29(26-19-12-9-13-20-26,27-21-14-10-15-22-27)28-23-16-11-17-24-28;/h9-17,19-24H,2-8,18,25H2,1H3;1H/q+1;/p-1
InChI Key GVPLMQGXUUHCSB-UHFFFAOYSA-M
Melting Point 90 °C
Purity 98%
Appearance Solid
Complexity 353
Covalently-Bonded Unit Count 2
Exact Mass 482.1738
Heavy Atom Count 30
Isomeric SMILES CCCCCCCCCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-]
Monoisotopic Mass 482.1738
Topological Polar Surface Area 0 Ų
Q&A

What is the IUPAC name of the compound?

The IUPAC name is decyl(triphenyl)phosphanium;bromide.

What is the molecular formula of the compound?

The molecular formula is C28H36BrP.

What is the exact mass of the compound?

The exact mass is 482.17380.

How many heavy atoms are present in the compound?

There are 30 heavy atoms in the compound.

How many rotatable bonds does the compound have?

The compound has 12 rotatable bonds.

How many covalently-bonded units are present in the compound?

There are 2 covalently-bonded units.

Does the compound have any defined atom stereocenters?

No, the compound does not have any defined atom stereocenters.

What is the Canonical SMILES representation of the compound?

The Canonical SMILES representation is CCCCCCCCCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-]

What is the CAS number of the compound?

The CAS number is 32339-43-8.

What is the Common Synonym for the compound?

A common synonym for the compound is Decyltriphenylphosphonium bromide.

Please kindly note that our products and services are for research use only.