(N-butyl)triphenylphosphonium bromide

Catalog Number	ACM1779517-2
CAS	1779-51-7
Structure
Synonyms	Butyltriphenylphosphonium bromide; (1-Butyl)Triphenylphosphonium Bromide; Phosphonium, butyltriphenyl-, bromide
IUPAC Name	butyl(triphenyl)phosphanium;bromide
Molecular Weight	399.31
Molecular Formula	C22H24PBr
InChI	IKWKJIWDLVYZIY-UHFFFAOYSA-M
InChI Key	InChI=1S/C22H24P.BrH/c1-2-3-19-23(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22;/h4-18H,2-3,19H2,1H3;1H/q+1;/p-1
Melting Point	240-243 °C(lit.)
Purity	98%
Appearance	Solid
Isomeric SMILES	CCCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-]

Q&A

What is the European Community (EC) Number for (N-butyl)triphenylphosphonium bromide?

The European Community (EC) Number is 217-219-4.

What is the Canonical SMILES representation of (N-butyl)triphenylphosphonium bromide?

The Canonical SMILES representation is CCCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-]

How many Computed Properties Defined Atom Stereocenter Count does (N-butyl)triphenylphosphonium bromide have?

(N-butyl)triphenylphosphonium bromide has 0 Computed Properties Defined Atom Stereocenter Count.

What is the Depositor-Supplied Synonym for (N-butyl)triphenylphosphonium bromide?

A Depositor-Supplied Synonym for (N-butyl)triphenylphosphonium bromide is Butyltriphenylphosphonium bromide.

What is the exact mass of (N-butyl)triphenylphosphonium bromide?

The exact mass of (N-butyl)triphenylphosphonium bromide is 398.07990.

Is (N-butyl)triphenylphosphonium bromide also known as Butyltriphenylphosphonium bromide, 99%?

Yes, (N-butyl)triphenylphosphonium bromide is also known as Butyltriphenylphosphonium bromide, 99%.

What is the IUPAC Name of (N-butyl)triphenylphosphonium bromide?

The IUPAC Name of (N-butyl)triphenylphosphonium bromide is butyl(triphenyl)phosphanium;bromide.

What is the Molecular Formula of (N-butyl)triphenylphosphonium bromide?

The Molecular Formula is C22H24BrP.

What are some other names or synonyms for (N-butyl)triphenylphosphonium bromide?

Some other names or synonyms include NSC59684, B-0970, n-butyl triphenyl-phosphonium bromide, and Hishicolin BTPPBr.