What is the IUPAC name of the compound N-(2-(Diphenylphosphino)benzyl)cyclohexanamine?
The IUPAC name is N-[(2-diphenylphosphanylphenyl)methyl]cyclohexanamine.
What is the molecular formula of N-(2-(Diphenylphosphino)benzyl)cyclohexanamine?
The molecular formula is C25H28NP.
What is the exact mass of N-(2-(Diphenylphosphino)benzyl)cyclohexanamine?
The exact mass is 373.195936895.
How many heavy atoms are present in the compound N-(2-(Diphenylphosphino)benzyl)cyclohexanamine?
There are 27 heavy atoms present.
What is the Canonical SMILES representation of N-(2-(Diphenylphosphino)benzyl)cyclohexanamine?
C1CCC(CC1)NCC2=CC=CC=C2P(C3=CC=CC=C3)C4=CC=CC=C4
How many rotatable bonds are present in N-(2-(Diphenylphosphino)benzyl)cyclohexanamine?
There are 6 rotatable bonds present.
What is the XLogP3 value of N-(2-(Diphenylphosphino)benzyl)cyclohexanamine?
The XLogP3 value is 5.8.
What is the InChIKey of N-(2-(Diphenylphosphino)benzyl)cyclohexanamine?
The InChIKey is ANSCOLJFBTVNQR-UHFFFAOYSA-N.
How many Covalently-Bonded Units are there in N-(2-(Diphenylphosphino)benzyl)cyclohexanamine?
There is 1 Covalently-Bonded Unit.
What is the PubChem CID for N-(2-(Diphenylphosphino)benzyl)cyclohexanamine?
The PubChem CID is 86017714.