3-Methyl-2-phenylpyridine

Catalog Number	ACM10273902-2
CAS	10273-90-2
Structure
Synonyms	2-Phenyl-β-picoline
IUPAC Name	3-methyl-2-phenylpyridine
Molecular Weight	169.22
Molecular Formula	C12H11N
Canonical SMILES	CC1=C(N=CC=C1)C2=CC=CC=C2
InChI	BJATUPPYBZHEIO-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H11N/c1-10-6-5-9-13-12(10)11-7-3-2-4-8-11/h2-9H,1H3
Boiling Point	160 °C
Melting Point	167-172 °C
Flash Point	96 °C
Purity	98%+
Density	1.065 g/cm³ at 25 °C
Appearance	Brown liqiud
Complexity	149
Covalently-Bonded Unit Count	1
EC Number	233-619-1
Exact Mass	169.089149g/mol
Formal Charge	0
Heavy Atom Count	13
Isomeric SMILES	CC1=C(N=CC=C1)C2=CC=CC=C2
Monoisotopic Mass	169.089149g/mol
Rotatable Bond Count	1

Q&A

What is the molecular weight of 3-Methyl-2-phenylpyridine?

The molecular weight of 3-Methyl-2-phenylpyridine is 169.22.

What are the product categories that 3-Methyl-2-phenylpyridine belongs to?

3-Methyl-2-phenylpyridine belongs to API intermediates, OLED materials, pharm chemical, and electronic product categories.

What is the boiling point of 3-Methyl-2-phenylpyridine?

The boiling point of 3-Methyl-2-phenylpyridine is 148°C (16 mmHg).

What is the storage temperature recommended for 3-Methyl-2-phenylpyridine?

The recommended storage temperature for 3-Methyl-2-phenylpyridine is in an inert atmosphere at room temperature.

What is the CAS number for 3-Methyl-2-phenylpyridine?

The CAS number for 3-Methyl-2-phenylpyridine is 10273-90-2.

What is the form of 3-Methyl-2-phenylpyridine?

The form of 3-Methyl-2-phenylpyridine is a clear liquid.

What is the density of 3-Methyl-2-phenylpyridine?

The density of 3-Methyl-2-phenylpyridine is 1.065.

What is the color of 3-Methyl-2-phenylpyridine?

The color of 3-Methyl-2-phenylpyridine is colorless to light yellow to light orange.

What is the hazard code associated with 3-Methyl-2-phenylpyridine?

The hazard code associated with 3-Methyl-2-phenylpyridine is Xn.

What are the safety statements for handling 3-Methyl-2-phenylpyridine?

The safety statements for handling 3-Methyl-2-phenylpyridine are 26-36/37/39.