4-Methyl-4'-carboxy-2,2'-bipyridine

Catalog Number	ACM103946549-1
CAS	103946-54-9
Structure
Synonyms	4'-Methyl-[2,2'-Bipyridine]-4-Carboxylic Acid; 2-(4-Methylpyridin-2-Yl)Pyridine-4-Carboxylic Acid
IUPAC Name	2-(4-methylpyridin-2-yl)pyridine-4-carboxylic acid
Molecular Weight	214.22
Molecular Formula	C12H10N2O2
InChI	LEJWPWXRHHUDRH-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H10N2O2/c1-8-2-4-13-10(6-8)11-7-9(12(15)16)3-5-14-11/h2-7H,1H3,(H,15,16)
Melting Point	280 °C
Purity	97%
Appearance	Solid
Isomeric SMILES	CC1=CC(=NC=C1)C2=NC=CC(=C2)C(=O)O

Q&A

What is the molecular weight of the compound 4-Methyl-4'-carboxy-2,2'-bipyridine?

The molecular weight is 214.22.

What are the product categories that 4-Methyl-4'-carboxy-2,2'-bipyridine belongs to?

Pyridines and API intermediates.

What is another name for 4-Methyl-4'-carboxy-2,2'-bipyridine?

4'-METHYL-2,2'-BIPYRIDINE-4-CARBOXYLIC ACID.

What is the melting point of 4-Methyl-4'-carboxy-2,2'-bipyridine?

The melting point is 280 °C.

In what form does 4-Methyl-4'-carboxy-2,2'-bipyridine exist?

It exists in a solid form.

What is the color of 4-Methyl-4'-carboxy-2,2'-bipyridine?

The color is Off-White to Pale Beige.

What is the solubility of 4-Methyl-4'-carboxy-2,2'-bipyridine in DMSO and Methanol?

It is slightly soluble in DMSO and Methanol.

What is the predicted boiling point of 4-Methyl-4'-carboxy-2,2'-bipyridine?

The predicted boiling point is 497.4±45.0 °C.

What is the storage temperature recommended for 4-Methyl-4'-carboxy-2,2'-bipyridine?

It should be stored in an inert atmosphere at room temperature.

What is the definition of 4-Methyl-4'-carboxy-2,2'-bipyridine according to ChEBI?

It is a member of the class of bipyridines that is 2,2'-bipyridine in which the hydrogens para to the ring nitrogens have been replaced by methyl and carboxy groups, and it is also classified as an aromatic carboxylic acid and a monocarboxylic acid.