5-Methyl-2,2'-bipyridine

Catalog Number	ACM56100200
CAS	56100-20-0
Structure
Synonyms	5-Methyl-2-Pyridin-2-Ylpyridine
IUPAC Name	5-methyl-2-pyridin-2-ylpyridine
Molecular Weight	170.21
Molecular Formula	C11H10N2
InChI	LECLRDWVJRSFSE-UHFFFAOYSA-N
InChI Key	InChI=1S/C11H10N2/c1-9-5-6-11(13-8-9)10-4-2-3-7-12-10/h2-8H,1H3
Purity	98%+
Isomeric SMILES	CC1=CN=C(C=C1)C2=CC=CC=N2

Q&A

What is the molecular weight of 5-Methyl-2,2'-bipyridine?

The molecular weight of 5-Methyl-2,2'-bipyridine is 170.21.

What are some synonyms for 5-Methyl-2,2'-bipyridine?

Some synonyms for 5-Methyl-2,2'-bipyridine include 5-Methyl-[2,2']bipyridinyl, 5-Methyl-2-pyridin-2-ylpyridine, and 2,2'-Bipyridine, 5-methyl-.

What is the boiling point of 5-Methyl-2,2'-bipyridine?

The boiling point is 92°C at a pressure of 0.05 Torr.

What is the chemical formula of 5-Methyl-2,2'-bipyridine?

The chemical formula of 5-Methyl-2,2'-bipyridine is C11H10N2.

How should 5-Methyl-2,2'-bipyridine be stored?

5-Methyl-2,2'-bipyridine should be sealed in dry conditions at room temperature.

What is the predicted density of 5-Methyl-2,2'-bipyridine?

The predicted density of 5-Methyl-2,2'-bipyridine is 1.081±0.06 g/cm3.

In what type of solvent is 5-Methyl-2,2'-bipyridine soluble?

5-Methyl-2,2'-bipyridine is soluble in DCM (dichloromethane).

What is the predicted pKa value of 5-Methyl-2,2'-bipyridine?

The predicted pKa value of 5-Methyl-2,2'-bipyridine is 4.39±0.20.

What is the HS Code for 5-Methyl-2,2'-bipyridine?

The HS Code for 5-Methyl-2,2'-bipyridine is 2933399990.

What are the uses of 5-Methyl-2,2'-bipyridine?

5-Methyl-2,2'-bipyridine is used as an intermediate in the synthesis of genetic incorporation of a metal-ion chelating amino acids into proteins as a biophysical probe.