4'-Methyl-[2,2'-bipyridine]-4-carbaldehyde

Catalog Number	ACM104704098-1
CAS	104704-09-8
Structure
Synonyms	4-Formyl-4'-methyl-2,2'-bipyridine; 2-(4-methylpyridin-2-yl)pyridine-4-carbaldehyde
IUPAC Name	2-(4-methylpyridin-2-yl)pyridine-4-carbaldehyde
Molecular Weight	198.22
Molecular Formula	C12H10N2O
InChI	SMPJZGCAUYUJJE-UHFFFAOYSA-N
InChI Key	InChI=1S/C12H10N2O/c1-9-2-4-13-11(6-9)12-7-10(8-15)3-5-14-12/h2-8H,1H3
Boiling Point	368.7±42.0 °C(Predicted)
Melting Point	130-131 °C
Purity	97%
Isomeric SMILES	CC1=CC(=NC=C1)C2=NC=CC(=C2)C=O

Q&A

What is the CAS number of the compound 4'-Methyl-[2,2'-bipyridine]-4-carbaldehyde?

The CAS number is 104704-09-8.

What is the molecular weight of 4'-Methyl-[2,2'-bipyridine]-4-carbaldehyde?

The molecular weight is 198.22.

What are some synonyms of 4'-Methyl-[2,2'-bipyridine]-4-carbaldehyde?

Some synonyms include 4-Formyl-4'-methyl-2,2'-bipyridine, [2,2'-Bipyridine]-4-carboxaldehyde, and 2-(4-methylpyridin-2-yl)pyridine-4-carbaldehyde.

What is the melting point of 4'-Methyl-[2,2'-bipyridine]-4-carbaldehyde?

The melting point is 130-131 °C.

What is the predicted density of 4'-Methyl-[2,2'-bipyridine]-4-carbaldehyde?

The predicted density is 1.172±0.06 g/cm3.

What is the predicted boiling point of 4'-Methyl-[2,2'-bipyridine]-4-carbaldehyde?

The predicted boiling point is 368.7±42.0 °C.

What is the predicted pka value of 4'-Methyl-[2,2'-bipyridine]-4-carbaldehyde?

The predicted pka value is 4.37±0.30.

How can 4'-Methyl-[2,2'-bipyridine]-4-carbaldehyde be defined in terms of its chemical structure?

It is defined as a member of the class of bipyridines in which hydrogens para to the ring nitrogens have been replaced by methyl and formyl groups.

What is the molecular formula of 4'-Methyl-[2,2'-bipyridine]-4-carbaldehyde?

The molecular formula is C12H10N2O.

What are some other names or identifiers for 4'-Methyl-[2,2'-bipyridine]-4-carbaldehyde?

It can be referred to as 4'-methyl-2,2'-bipyridine-4-carboxaldehyde, 4-Formyl-4'-methyl-2,2'-bipyridinene-4-carbaldehyde, and Anthracene-2,11-dicarboxylic acid.