Methyl 1,10-phenanthroline-2-carboxylate

Catalog Number	ACM37067122
CAS	37067-12-2
Structure
Synonyms	1,10-Phenanthroline-2-Carboxylic Acid, Methyl Ester
IUPAC Name	methyl 1,10-phenanthroline-2-carboxylate
Molecular Weight	238.24
Molecular Formula	C14H10N2O2
InChI	MXUOTHREEOKGBO-UHFFFAOYSA-N
InChI Key	InChI=1S/C14H10N2O2/c1-18-14(17)11-7-6-10-5-4-9-3-2-8-15-12(9)13(10)16-11/h2-8H,1H3
Purity	98%
Isomeric SMILES	COC(=O)C1=NC2=C(C=CC3=C2N=CC=C3)C=C1

Q&A

What is the CAS number for Methyl 1,10-phenanthroline-2-carboxylate?

The CAS number is 37067-12-2.

What is the molecular weight of Methyl 1,10-phenanthroline-2-carboxylate?

The molecular weight is 238.24.

What are some synonyms for Methyl 1,10-phenanthroline-2-carboxylate?

Some synonyms include Methyl 1,10-phenanthroline-2-carboxylate and 1,10-Phenanthroline-2-carboxylic acid, methyl ester.

What is the chemical formula for Methyl 1,10-phenanthroline-2-carboxylate?

The chemical formula is C14H10N2O2.

How many carbon atoms are present in Methyl 1,10-phenanthroline-2-carboxylate?

There are 14 carbon atoms present.

How many nitrogen atoms are present in Methyl 1,10-phenanthroline-2-carboxylate?

There are 2 nitrogen atoms present.

What is the IUPAC name for Methyl 1,10-phenanthroline-2-carboxylate?

The IUPAC name is Methyl 1,10-phenanthroline-2-carboxylate.

What is the formula for calculating the molecular weight of a compound?

The formula is sum of the atomic weights of all atoms present in the compound.

Why is Methyl 1,10-phenanthroline-2-carboxylate used in research?

It may be used as a ligand in coordination chemistry.

Are there any known applications of Methyl 1,10-phenanthroline-2-carboxylate in industry?

It may be used as a reagent in chemical synthesis.