Magnesium carbonate hydrate

Catalog Number	ACM23389335-1
CAS	23389-33-5
Structure
Synonyms	Magnesium carbonate, N-hydrate
Molecular Weight	102.33
Molecular Formula	CH2MgO4
Canonical SMILES	C(=O)([O-])[O-].O.[Mg+2]
InChI	InChI=1S/CH2O3.Mg.H2O/c2-1(3)4;/h(H2,2,3,4);1H2/q;+2;/p-2
InChI Key	OUHCLAKJJGMPSW-UHFFFAOYSA-L
Purity	99%
Appearance	Neat
Exact Mass	101.9803502
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Monoisotopic Mass	101.9803502
Rotatable Bond Count	0
Topological Polar Surface Area	64.2

Q&A

What is the chemical formula for magnesium carbonate hydrate?

The chemical formula for magnesium carbonate hydrate is CMgO3.

What is the molecular weight of magnesium carbonate hydrate?

The molecular weight of magnesium carbonate hydrate is 84.31 g/mol.

What is the melting point of magnesium carbonate hydrate?

The melting point of magnesium carbonate hydrate is 2200 °C.

What are some synonyms for magnesium carbonate hydrate?

Some synonyms for magnesium carbonate hydrate include MAGNESIUM CARBONATE BASIC HYDRATE, MAGNESIUM CARBONATE, and MAGNESIA 81811.

What is the storage temperature recommended for magnesium carbonate hydrate?

The storage temperature recommended for magnesium carbonate hydrate is Room Temperature, under inert atmosphere.

How is magnesium carbonate hydrate prepared?

Magnesium carbonate hydrate can be prepared by mixing solutions of magnesium and carbonate ions in the presence of carbon dioxide.

What are some common uses of magnesium carbonate?

Some common uses of magnesium carbonate include in pharmaceuticals, cosmetics, heat insulation, rubber reinforcement, and as a drying agent in foods.

What is the solubility product constant (Ksp) for magnesium carbonate hydrate?

The solubility product constant (Ksp) for magnesium carbonate hydrate is pKsp: 5.17.

How is the anhydrous salt of magnesium carbonate prepared?

The anhydrous salt of magnesium carbonate can be made under very high partial pressures of carbon dioxide.

What is the composition of the basic carbonate produced by drying magnesium carbonate trihydrate?

The composition of the basic carbonate produced by drying magnesium carbonate trihydrate is 4MgCO3 ·Mg(OH)2·4H2O.