Ir(dmppy-ph)2tmd

Catalog Number	ACM2050041615-1
CAS	2050041-61-5
Structure
Synonyms	2-(3,5-Dimethylbenzene-6-id-1-yl)-4-phenylpyridine;iridium(3+);3-methanidyl-5-methanidylidene-2,2,6,6-tetramethylhept-3-ene
Molecular Weight	628.9
Molecular Formula	C32H38IrN
Canonical SMILES	CC1=CC(=[C-]C(=C1)C2=NC=CC(=C2)C3=CC=CC=C3)C.CC(C)(C)C(=CC(=[CH-])C(C)(C)C)[CH2-].[Ir+3]
InChI	InChI=1S/C19H16N.C13H22.Ir/c1-14-10-15(2)12-18(11-14)19-13-17(8-9-20-19)16-6-4-3-5-7-16;1-10(12(3,4)5)9-11(2)13(6,7)8;/h3-11,13H,1-2H3;1,9H,2H2,3-8H3;/q-1;-2;+3
InChI Key	RCYUNRKLKWPMLI-UHFFFAOYSA-N
Exact Mass	629.26335
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	0
Monoisotopic Mass	629.26335
Rotatable Bond Count	3
Topological Polar Surface Area	12.9 Ų

Q&A

What is the chemical formula of the compound with Ir(dmppy-ph)2tmd "Ir(dmppy-ph)2tmd"?

The chemical formula of the compound is C49H51IrN2O2.

What is the molecular weight of the compound with Ir(dmppy-ph)2tmd "Ir(dmppy-ph)2tmd"?

The molecular weight of the compound is 892.18 g/mol.

How many iridium atoms are present in the compound with Ir(dmppy-ph)2tmd "Ir(dmppy-ph)2tmd"?

The compound contains one iridium atom.

What are the synonyms for the compound with Ir(dmppy-ph)2tmd "Ir(dmppy-ph)2tmd"?

The synonyms are Bis(2-(3,5-dimethylphenyl)-4-phenylpyridine)(2,2,6,6-tetramethylheptane-3,5-diketonate)iridium(III).

What are the two ligands attached to the iridium atom in the compound with Ir(dmppy-ph)2tmd "Ir(dmppy-ph)2tmd"?

The two ligands attached to the iridium atom are 2-(3,5-dimethylphenyl)-4-phenylpyridine and 2,2,6,6-tetramethylheptane-3,5-diketonate.

How many nitrogen atoms are present in the compound with Ir(dmppy-ph)2tmd "Ir(dmppy-ph)2tmd"?

The compound contains 2 nitrogen atoms.

What is the full name of the compound represented by Ir(dmppy-ph)2tmd "Ir(dmppy-ph)2tmd"?

The full name of the compound is Bis(2-(3,5-dimethylphenyl)-4-phenylpyridine)(2,2,6,6-tetramethylheptane-3,5-diketonate)iridium(III).

What is the chemical structure of the compound with Ir(dmppy-ph)2tmd "Ir(dmppy-ph)2tmd"?

The chemical structure includes two ligands connected to the central iridium atom.

What is the role of the compound with Ir(dmppy-ph)2tmd "Ir(dmppy-ph)2tmd" in chemical reactions?

The compound may serve as a catalyst or a photoluminescent material due to the presence of the iridium central atom.