Hematoporphyrin IX dimethyl ester

Catalog Number	ACM5594296-1
CAS	5594-29-6
Structure
Synonyms	Methyl 3-[8,13-Bis(1-Hydroxyethyl)-18-(3-Methoxy-3-Oxopropyl)-3,7,12,17-Tetramethyl-22,23-Dihydroporphyrin-2-Yl]Propanoate
IUPAC Name	methyl 3-[8,13-bis(1-hydroxyethyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate
Molecular Weight	626.75
Molecular Formula	C36H42N4O6
InChI	LOXJDOVVTYSVAS-UHFFFAOYSA-N
InChI Key	InChI=1S/C36H42N4O6/c1-17-23(9-11-33(43)45-7)29-16-30-24(10-12-34(44)46-8)18(2)26(38-30)14-31-36(22(6)42)20(4)28(40-31)15-32-35(21(5)41)19(3)27(39-32)13-25(17)37-29/h13-16,21-22,39-42H,9-12H2,1-8H3
Purity	97%
Isomeric SMILES	CC1=C(C2=CC3=NC(=CC4=NC(=CC5=C(C(=C(N5)C=C1N2)C(C)O)C)C(=C4CCC(=O)OC)C)C(=C3C)CCC(=O)OC)C(C)O

Q&A

What is the molecular weight of Hematoporphyrin IX dimethyl ester?

The molecular weight of Hematoporphyrin IX dimethyl ester is 626.74.

What are the product categories that Hematoporphyrin IX dimethyl ester falls under?

Hematoporphyrin IX dimethyl ester falls under Natural Porphyrins and Derivatives and Porphyrins.

What is another name for Hematoporphyrin IX dimethyl ester?

Another name for Hematoporphyrin IX dimethyl ester is DIMETHYL-8,13-BIS(1-HYDROXYETHYL)-3,7,12,17-TETRAMETHYL-21H,23H-PORPHINE-2,18-DIPROPIONATE.

What is the chemical formula for Hematoporphyrin IX dimethyl ester?

The chemical formula for Hematoporphyrin IX dimethyl ester is C36H42N4O6.

What is the main use of Hematoporphyrin IX dimethyl ester?

Hematoporphyrin IX dimethyl ester is mainly used for research purposes.

What is the CAS number for Hematoporphyrin IX dimethyl ester?

The CAS number for Hematoporphyrin IX dimethyl ester is 5594-29-6.

What type of derivative is Hematoporphyrin IX dimethyl ester?

Hematoporphyrin IX dimethyl ester is a hematoporphyrin derivative.

Can Hematoporphyrin IX dimethyl ester be used in medical applications?

Hematoporphyrin IX dimethyl ester is primarily used for research purposes and may not be suitable for medical applications.

In what form is Hematoporphyrin IX dimethyl ester commonly found?

Hematoporphyrin IX dimethyl ester is commonly found in its dimethyl ester form.

What are some potential research applications for Hematoporphyrin IX dimethyl ester?

Hematoporphyrin IX dimethyl ester may be used in research related to porphyrin derivatives and their properties, as well as in studies involving hematoporphyrin IX.