| Catalog Number |
ACM1774114-1 |
| CAS |
1774-11-4 |
| Structure |
 |
| Description |
5-(2-Furyl)cyclohexane-1,3-dione, commonly known as 5-furyl-1,3-diketone, is a cyclic ketone whose structure consists of two fused cyclohexane rings, with a single oxygen atom connecting the rings and two oxygen atoms at the end of the molecule. This compound is a colorless, crystalline solid that is insoluble in water but soluble in organic solvents. It is a versatile compound with many applications in the scientific field, such as synthesis, research, and lab experiments. |
| IUPAC Name |
5-(furan-2-yl)cyclohexane-1,3-dione |
| Molecular Weight |
178.18 g/mol |
| Molecular Formula |
C10H10O3 |
| Canonical SMILES |
C1C(CC(=O)CC1=O)C2=CC=CO2 |
| InChI |
InChI=1S/C10H10O3/c11-8-4-7(5-9(12)6-8)10-2-1-3-13-10/h1-3,7H,4-6H2 |
| InChI Key |
FYLTVHCMIYGVPZ-UHFFFAOYSA-N |
| Application |
5-furyl-1,3-diketone is a versatile compound with many applications in scientific research. It has been used in the synthesis of a variety of compounds, including pharmaceuticals, agrochemicals, and dyes. It has also been used in the preparation of cyclic peptides and peptidomimetics, as well as in the synthesis of other heterocyclic compounds. Additionally, 5-furyl-1,3-diketone has been used in the synthesis of organometallic compounds and as a reagent in the synthesis of various organic compounds. |
| Properties |
The biochemical and physiological effects of 5-furyl-1,3-diketone are not well-studied. However, some studies suggest that the compound may have antioxidant, anti-inflammatory, and anti-microbial properties. Additionally, the compound has been found to inhibit the growth of certain bacteria and fungi, as well as to possess antifungal activity. |
