ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

(Formylmethyl)triphenylphosphonium chloride

Catalog Number ACM62942432-1
CAS 62942-43-2
Structure {[CurrentData.Name]}
Synonyms (2-Oxoethyl)triphenylphosphonium chloride; 2-(Triphenylphosphino)ethanal chloride
IUPAC Name 2-oxoethyl(triphenyl)phosphanium;chloride
Molecular Weight 340.78
Molecular Formula C20H18OPCl
Canonical SMILES C1=CC=C(C=C1)[P+](CC=O)(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-]
InChI RVEJRPJGKXTQIF-UHFFFAOYSA-M
InChI Key InChI=1S/C20H18OP.ClH/c21-16-17-22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20;/h1-16H,17H2;1H/q+1;/p-1
Melting Point 209-212 °C(dec.)(lit.)
Purity 98%+
Appearance Solid
EC Number 263-767-2
Exact Mass 340.07800
Isomeric SMILES C1=CC=C(C=C1)[P+](CC=O)(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-]
Packing Group III
Q&A

What is the CAS number for (Formylmethyl)triphenylphosphonium chloride?

The CAS number for (Formylmethyl)triphenylphosphonium chloride is 62942-43-2.

What is the molecular formula of (Formylmethyl)triphenylphosphonium chloride?

The molecular formula of (Formylmethyl)triphenylphosphonium chloride is C20H18ClOP.

What is the exact mass of (Formylmethyl)triphenylphosphonium chloride?

The exact mass of (Formylmethyl)triphenylphosphonium chloride is 340.0783799.

How many hydrogen bond acceptors are there in (Formylmethyl)triphenylphosphonium chloride?

There are 2 hydrogen bond acceptors in (Formylmethyl)triphenylphosphonium chloride.

What is the Computed Properties Heavy Atom Count of (Formylmethyl)triphenylphosphonium chloride?

The Computed Properties Heavy Atom Count of (Formylmethyl)triphenylphosphonium chloride is 23.

What are some synonyms for (Formylmethyl)triphenylphosphonium chloride?

Some synonyms for (Formylmethyl)triphenylphosphonium chloride include MFCD00012003, BCP22576, and Formylmethyl triphenylphosphonium chloride.

What is the IUPAC name of (Formylmethyl)triphenylphosphonium chloride?

The IUPAC name of (Formylmethyl)triphenylphosphonium chloride is 2-oxoethyl(triphenyl)phosphanium; chloride.

How many Covalently-Bonded Unit Counts are there in (Formylmethyl)triphenylphosphonium chloride?

There are 2 Covalently-Bonded Unit Counts in (Formylmethyl)triphenylphosphonium chloride.

What is the Canonical SMILES representation of (Formylmethyl)triphenylphosphonium chloride?

The Canonical SMILES representation of (Formylmethyl)triphenylphosphonium chloride is C1=CC=C(C=C1)[P+](CC=O)(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-].

What is the topological polar surface area of (Formylmethyl)triphenylphosphonium chloride?

The topological polar surface area of (Formylmethyl)triphenylphosphonium chloride is 17.1.

Please kindly note that our products and services are for research use only.