Ferrous acetylacetonate

Catalog Number	ACM14024170-3
CAS	14024-17-0
Structure
Synonyms	Iron acetylacetonate
Molecular Weight	256.08
Molecular Formula	C10H16FeO4
Canonical SMILES	CC(=CC(=O)C)O.CC(=CC(=O)C)O.[Fe]
InChI	InChI=1S/2C5H8O2.Fe/c2*1-4(6)3-5(2)7;/h2*3,6H,1-2H3;/b2*4-3-;
InChI Key	LFKXWKGYHQXRQA-FDGPNNRMSA-N
Melting Point	175 °C
Purity	99%+
Appearance	Powder
Exact Mass	256.039795
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	2
Isomeric SMILES	C/C(=C/C(=O)C)/O.C/C(=C/C(=O)C)/O.[Fe]
Monoisotopic Mass	256.039795
Rotatable Bond Count	2
Topological Polar Surface Area	74.6 Ų

Q&A

What is the molecular weight of Ferrous acetylacetonate?

The molecular weight of Ferrous acetylacetonate is 254.06.

What are some synonyms for Ferrous acetylacetonate?

Some synonyms for Ferrous acetylacetonate include (Acetylacetonato)iron, Bis(2,4-pentanedionato)iron, and Iron bis(acetylacetonate).

What is the melting point of Ferrous acetylacetonate?

The melting point of Ferrous acetylacetonate is 175 °C.

In what solvents is Ferrous acetylacetonate slightly soluble?

Ferrous acetylacetonate is slightly soluble in benzene and toluene.

What is the color of Ferrous acetylacetonate crystals?

The crystals of Ferrous acetylacetonate are orange-brown.

How should Ferrous acetylacetonate be stored?

Ferrous acetylacetonate should be stored in an inert atmosphere at room temperature.

What are the hazard codes associated with Ferrous acetylacetonate?

The hazard code associated with Ferrous acetylacetonate is Xi.

What are the safety statements for Ferrous acetylacetonate?

The safety statements for Ferrous acetylacetonate are 26 and 36.

What are the risk statements for Ferrous acetylacetonate?

The risk statements for Ferrous acetylacetonate are 36/37/38.

In which country is Ferrous acetylacetonate classified as WGK 3 (Water Hazard class)?

Ferrous acetylacetonate is classified as WGK 3 in Germany.