Etioporphyrin III

Catalog Number	ACM26608344-2
CAS	26608-34-4
Structure
Synonyms	3,7,12,17-Tetraethyl-2,8,13,18-tetramethyl-21,22-dihydroporphyrin
IUPAC Name	3,7,12,17-tetraethyl-2,8,13,18-tetramethyl-21,22-dihydroporphyrin
Molecular Weight	479.00
Molecular Formula	C32H38N4
InChI	SOZGZCJUYXLGOI-UHFFFAOYSA-N
InChI Key	InChI=1S/C32H38N4/c1-9-21-17(5)25-13-26-18(6)23(11-3)31(34-26)16-32-24(12-4)20(8)28(36-32)15-30-22(10-2)19(7)27(35-30)14-29(21)33-25/h13-16,34,36H,9-12H2,1-8H3
Boiling Point	360-363 °C
Melting Point	360-363 °C
Purity	98%
Appearance	Purple crystal solid
Isomeric SMILES	CCC1=C(C2=CC3=NC(=CC4=NC(=CC5=C(C(=C(N5)C=C1N2)CC)C)C(=C4C)CC)C(=C3C)CC)C

Q&A

What is the molecular weight of Etioporphyrin III?

The molecular weight of Etioporphyrin III is 478.67.

What are the product categories that Etioporphyrin III belongs to?

Etioporphyrin III belongs to the product category of porphine (porphyrin) ligand.

What are some synonyms for Etioporphyrin III?

Some synonyms for Etioporphyrin III are 3,8,13,17-tetraethyl-2,7,12,18-tetramethylporphyrin, Etioporphyrin Ⅲ, and 2,7,12,18-Tetraethyl-3,8,13,17-tetramethyl-21H,23H-porphyrin.

What is the molecular formula of Etioporphyrin III?

The molecular formula of Etioporphyrin III is C32H38N4.

What is the melting point of Etioporphyrin III?

The melting point of Etioporphyrin III is 360-363°C.

What is the predicted boiling point of Etioporphyrin III?

The predicted boiling point of Etioporphyrin III is 792.7±55.0°C.

What is the pKa value of Etioporphyrin III at 25°C?

The pKa value of Etioporphyrin III at 25°C is 18.

In what form does Etioporphyrin III exist?

Etioporphyrin III exists in the form of crystals.

What is the predicted density of Etioporphyrin III?

The predicted density of Etioporphyrin III is 1.101±0.06 g/cm3.

What is the color of Etioporphyrin III?

The color of Etioporphyrin III is purple.