ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Ethyl 6,6''-bis(bromomethyl)-[2,2':6',2''-terpyridine]-4'-carboxylate

Catalog Number ACM372520859-1
CAS 372520-85-9
Structure {[CurrentData.Name]}
Synonyms 6,6''-Bis(Bromomethyl)-[2,2':6',2''-Terpyridine]-4'-Carboxylic Acid Ethyl Ester; 2,6-Bis[6-(bromomethyl)pyridin-2-yl]pyridine-4-carboxylate
IUPAC Name ethyl 2,6-bis[6-(bromomethyl)pyridin-2-yl]pyridine-4-carboxylate
Molecular Weight 491.18
Molecular Formula C20H17Br2N3O2
InChI DRSSOZTTWXYVKX-UHFFFAOYSA-N
InChI Key InChI=1S/C20H17Br2N3O2/c1-2-27-20(26)13-9-18(16-7-3-5-14(11-21)23-16)25-19(10-13)17-8-4-6-15(12-22)24-17/h3-10H,2,11-12H2,1H3
Purity 98%
Isomeric SMILES CCOC(=O)C1=CC(=NC(=C1)C2=CC=CC(=N2)CBr)C3=CC=CC(=N3)CBr
Q&A

What is the chemical formula for Ethyl 6,6''-bis(bromomethyl)-[2,2':6',2''-terpyridine]-4'-carboxylate?

The chemical formula is C20H17Br2N3O2.

What is the molecular weight of Ethyl 6,6''-bis(bromomethyl)-[2,2':6',2''-terpyridine]-4'-carboxylate?

The molecular weight is 491.18 g/mol.

What are some synonyms for Ethyl 6,6''-bis(bromomethyl)-[2,2':6',2''-terpyridine]-4'-carboxylate?

Synonyms include 6,6''-BIS(BROMOMETHYL)-[2,2':6',2''-TERPYRIDINE]-4'-CARBOXYLIC ACID ETHYL ESTER, 6,6''''-Bis(bromomethyl)-[2,2'':6'',2''''-terpyridine]-4''-carboxylic acid ethyl ester, and more.

What is the predicted boiling point of Ethyl 6,6''-bis(bromomethyl)-[2,2':6',2''-terpyridine]-4'-carboxylate?

The predicted boiling point is 569.7°C ±50.0°C.

What is the predicted pKa value of Ethyl 6,6''-bis(bromomethyl)-[2,2':6',2''-terpyridine]-4'-carboxylate?

The predicted pKa value is 1.29 ±0.46.

What is the predicted density of Ethyl 6,6''-bis(bromomethyl)-[2,2':6',2''-terpyridine]-4'-carboxylate?

The predicted density is 1.568 g/cm3 ±0.06.

Are there any other chemical names for Ethyl 6,6''-bis(bromomethyl)-[2,2':6',2''-terpyridine]-4'-carboxylate?

Yes, another chemical name is [2,2':6',2''-Terpyridine]-4'-carboxylic acid, 6,6''-bis(bromomethyl)-, ethyl ester.

What are the predicted physical properties of Ethyl 6,6''-bis(bromomethyl)-[2,2':6',2''-terpyridine]-4'-carboxylate?

The predicted boiling point, pKa value, and density are part of the physical properties.

How many bromine atoms are present in the molecule?

There are two bromine atoms in the molecule.

How many oxygen atoms are present in the molecule?

There are two oxygen atoms in the molecule.

Please kindly note that our products and services are for research use only.