ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Ethanediamide, N1,N2-bis([1,1'-biphenyl]-2-yl)-

Catalog Number ACM21022173
CAS 21022-17-3
Synonyms N,N'-Di([1,1'-biphenyl]-2-yl)ethanediamide; N,N'-Bis(2-Phenylphenyl)ethanediamide
IUPAC Name N,N'-bis(2-phenylphenyl)oxamide
Molecular Weight 392.45
Molecular Formula C26H20N2O2
InChI VKRWRNVGVPSVLA-UHFFFAOYSA-N
InChI Key InChI=1S/C26H20N2O2/c29-25(27-23-17-9-7-15-21(23)19-11-3-1-4-12-19)26(30)28-24-18-10-8-16-22(24)20-13-5-2-6-14-20/h1-18H,(H,27,29)(H,28,30)
Purity 98%
Appearance Solid
Isomeric SMILES C1=CC=C(C=C1)C2=CC=CC=C2NC(=O)C(=O)NC3=CC=CC=C3C4=CC=CC=C4
Q&A

What is the chemical formula for N1,N2-Bis([1,1'-biphenyl]-2-yl)ethanediamide?

The chemical formula is C26H20N2O2.

What is the molecular weight of N1,N2-Bis([1,1'-biphenyl]-2-yl)ethanediamide?

The molecular weight is 392.45 g/mol.

What are some synonyms for Ethanediamide, N1,N2-bis([1,1'-biphenyl]-2-yl)-?

Some synonyms include N,N'-Di([1,1'-biphenyl]-2-yl)ethanediamide, N1,N2-Di([1,1'-biphenyl]-2-yl)oxalamide, and N,N'-bis(2-phenylphenyl)oxamide.

What is the predicted density of N1,N2-Bis([1,1'-biphenyl]-2-yl)ethanediamide?

The predicted density is 1.249 g/cm3.

What is the predicted pka value of N1,N2-Bis([1,1'-biphenyl]-2-yl)ethanediamide?

The predicted pka value is 10.81.

What is the color of N1,N2-Bis([1,1'-biphenyl]-2-yl)ethanediamide?

The color is white.

How should N1,N2-Bis([1,1'-biphenyl]-2-yl)ethanediamide be stored?

It should be kept in a dark place, in an inert atmosphere, at room temperature.

In what form does N1,N2-Bis([1,1'-biphenyl]-2-yl)ethanediamide come in?

It comes in powder form.

What is the HS Code for N1,N2-Bis([1,1'-biphenyl]-2-yl)ethanediamide?

The HS Code is 2924297099.

What are other names used for N1,N2-Bis([1,1'-biphenyl]-2-yl)ethanediamide?

Other names include N1,N2-Di(2-biphenylyl)oxalamide and N,N'-di(biphenyl-2-yl)ethanediamide.

Please kindly note that our products and services are for research use only.