ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Ethane-1,2-diylbis(phenylphosphinic acid)

Catalog Number ACM1089776
CAS 1089-77-6
Structure {[CurrentData.Name]}
Synonyms 2-[Hydroxy(Phenyl)Phosphoryl]Ethyl-Phenylphosphinic Acid
IUPAC Name 2-[hydroxy(phenyl)phosphoryl]ethyl-phenylphosphinic acid
Molecular Weight 310.22
Molecular Formula C14H16O4P2
InChI FYLYSEXHKNLCOF-UHFFFAOYSA-N
InChI Key InChI=1S/C14H16O4P2/c15-19(16,13-7-3-1-4-8-13)11-12-20(17,18)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,15,16)(H,17,18)
Purity 95%
Isomeric SMILES C1=CC=C(C=C1)P(=O)(CCP(=O)(C2=CC=CC=C2)O)O
Q&A

What is the IUPAC name of the compound Ethane-1,2-diylbis(phenylphosphinic acid)?

The IUPAC name of the compound is 2-[hydroxy(phenyl)phosphoryl]ethyl-phenylphosphinic acid.

What is the molecular formula of Ethane-1,2-diylbis(phenylphosphinic acid)?

The molecular formula is C14H16O4P2.

What is the exact mass of Ethane-1,2-diylbis(phenylphosphinic acid)?

The exact mass is 310.05238298.

How many hydrogen bond acceptor counts does Ethane-1,2-diylbis(phenylphosphinic acid) have?

It has 4 hydrogen bond acceptor counts.

What is the canonical SMILES representation of Ethane-1,2-diylbis(phenylphosphinic acid)?

The canonical SMILES is C1=CC=C(C=C1)P(=O)(CCP(=O)(C2=CC=CC=C2)O)O.

What is the computed properties complexity of Ethane-1,2-diylbis(phenylphosphinic acid)?

The computed properties complexity is 360.

What is the CAS number of Ethane-1,2-diylbis(phenylphosphinic acid)?

The CAS number is 1089-77-6.

How many heavy atoms are present in Ethane-1,2-diylbis(phenylphosphinic acid)?

There are 20 heavy atoms present.

What is the InChIKey of Ethane-1,2-diylbis(phenylphosphinic acid)?

The InChIKey is FYLYSEXHKNLCOF-UHFFFAOYSA-N.

Can you provide a synonym for Ethane-1,2-diylbis(phenylphosphinic acid)?

A synonym for Ethane-1,2-diylbis(phenylphosphinic acid) is P,P'-(1,2-Ethanediyl)bis[2-phenylphosphinic acid].

Please kindly note that our products and services are for research use only.