Disodium hexachloroosmate

Catalog Number	ACM1307819-1
CAS	1307-81-9
Structure
Synonyms	Sodium hexachloroosmate(IV)
Molecular Weight	448.9
Molecular Formula	Cl6Na2Os
Canonical SMILES	[Na+].[Na+].Cl[Os-2](Cl)(Cl)(Cl)(Cl)Cl
InChI	InChI=1S/6ClH.2Na.Os/h6*1H;/q;2*+1;+4/p-6
InChI Key	PVTVRPSPEDISMV-UHFFFAOYSA-H
Purity	98%+
Appearance	Powder
Complexity	62.7
Covalently-Bonded Unit Count	3
Defined Atom Stereocenter Count	0
Exact Mass	449.75118
Heavy Atom Count	9
Hydrogen Bond Acceptor Count	1
Hydrogen Bond Donor Count	0
Monoisotopic Mass	447.75413
Rotatable Bond Count	0
Topological Polar Surface Area	0 Ų

Q&A

What is the chemical formula for disodium hexachloroosmate?

The chemical formula for disodium hexachloroosmate is Cl6Na2Os.

What is the water solubility of disodium hexachloroosmate?

Disodium hexachloroosmate is insoluble in water.

What color is disodium hexachloroosmate typically?

Disodium hexachloroosmate is typically brown to black in color.

What are the risk statements associated with disodium hexachloroosmate?

The risk statements associated with disodium hexachloroosmate are 26/27/28-34.

What are the safety statements for handling disodium hexachloroosmate?

The safety statements for handling disodium hexachloroosmate are 26-36/37/39-45.

What is the hazard class of disodium hexachloroosmate?

Disodium hexachloroosmate is classified as Hazard Class 8.

What are some of the synonyms for disodium hexachloroosmate?

Some synonyms for disodium hexachloroosmate include Os 38.7% min, sodium hexachloroosmiate(IV) dihydrate, and osmium sodium chloride.

What is the product category of disodium hexachloroosmate?

Disodium hexachloroosmate falls under the category of halometallate salts.

How is disodium hexachloroosmate used in organic synthesis?

Disodium hexachloroosmate is used as an intermediate and catalyst in organic synthesis.

What other compound can be prepared using disodium hexachloroosmate?

Disodium hexachloroosmate is used to prepare dihydrogen complexes of osmium(II) containing meso-tetraphos-1 ligand.