2,2'-Dipyridyl-d8

Catalog Number	ACM32190424-1
CAS	32190-42-4
Structure
Synonyms	2,2'-Bipyridine; α,α'-Dipyridyl
IUPAC Name	2,3,4,5-tetradeuterio-6-(3,4,5,6-tetradeuteriopyridin-2-yl)pyridine
Molecular Weight	164.24
Molecular Formula	C10D8N2
Canonical SMILES	C1=CC=NC(=C1)C2=CC=CC=N2
InChI	ROFVEXUMMXZLPA-PGRXLJNUSA-N
InChI Key	InChI=1S/C10H8N2/c1-3-7-11-9(5-1)10-6-2-4-8-12-10/h1-8H/i1D,2D,3D,4D,5D,6D,7D,8D
Boiling Point	273 °C-lit.
Melting Point	70-73 °C-lit.
Exact Mass	164.118962231
Heavy Atom Count	12
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Isomeric SMILES	[2H]C1=C(C(=NC(=C1[2H])C2=C(C(=C(C(=N2)[2H])[2H])[2H])[2H])[2H])[2H]
Monoisotopic Mass	164.118962231
Rotatable Bond Count	1
Topological Polar Surface Area	25.8 Ų

Q&A

What is the chemical formula of 2,2'-Dipyridyl-d8?

The chemical formula of 2,2'-Dipyridyl-d8 is C10D8N2.

What is the molecular weight of 2,2'-Dipyridyl-d8?

The molecular weight of 2,2'-Dipyridyl-d8 is 164.23.

What is the melting point of 2,2'-Dipyridyl-d8?

The melting point of 2,2'-Dipyridyl-d8 is 70-73 °C.

In what form does 2,2'-Dipyridyl-d8 exist at room temperature?

2,2'-Dipyridyl-d8 exists in a solid form at room temperature.

What is the boiling point of 2,2'-Dipyridyl-d8?

The boiling point of 2,2'-Dipyridyl-d8 is 273 °C.

What is the color of 2,2'-Dipyridyl-d8?

The color of 2,2'-Dipyridyl-d8 is white to off-white.

What is the hazard code associated with 2,2'-Dipyridyl-d8?

The hazard code associated with 2,2'-Dipyridyl-d8 is T.

What safety statements should be followed when handling 2,2'-Dipyridyl-d8?

Safety Statements 26-45 should be followed when handling 2,2'-Dipyridyl-d8.

What is the designated Packing Group for 2,2'-Dipyridyl-d8?

The Packing Group for 2,2'-Dipyridyl-d8 is III.

What are the uses of 2,2'-Dipyridyl-d8?

2,2'-Dipyridyl-d8 is used in the NMR study of soft porous nanocrystal and a bulk crystal.