Dipyrido[3,2-a:2',3'-c]phenazine

Catalog Number	ACM19535478-2
CAS	19535-47-8
Synonyms	Dipyridoacphenazinehemihydratemin
IUPAC Name	quinoxalino[2,3-f][1,10]phenanthroline
Molecular Weight	282.30
Molecular Formula	C18H10N4
Canonical SMILES	C1=CC=C2C(=C1)N=C3C4=C(C5=C(C3=N2)C=CC=N5)N=CC=C4
InChI	BVQAWSJMUYMNQN-UHFFFAOYSA-N
InChI Key	InChI=1S/C18H10N4/c1-2-8-14-13(7-1)21-17-11-5-3-9-19-15(11)16-12(18(17)22-14)6-4-10-20-16/h1-10H
Boiling Point	254-255°C
Melting Point	254-255 °C
Purity	98%
Appearance	Brown Solid
Complexity	376
Covalently-Bonded Unit Count	1
Exact Mass	282.090546336
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	0
Monoisotopic Mass	282.090546336
Rotatable Bond Count	0
Topological Polar Surface Area	51.6 Ų

Q&A

What is the molecular weight of Dipyrido[3,2-a:2',3'-c]phenazine?

The molecular weight of Dipyrido[3,2-a:2',3'-c]phenazine is 282.3.

What is the product name for Dipyrido[3,2-a:2',3'-c]phenazine hemihydrate?

The product name is DIPYRIDO[3,2-A:2',3'-C]PHENAZINE HEMIHYDRATE, MIN. 98.

What are some synonyms for Dipyrido[3,2-a:2',3'-c]phenazine hemihydrate?

Some synonyms include Dipyrido[3,2-a:2',3'-c], Dipyrido[3,2-a:2',3'-c]phenazine, and DPPZ.

What is the chemical formula of Dipyrido[3,2-a:2',3'-c]phenazine?

The chemical formula is C18H10N4.

What is the melting point of Dipyrido[3,2-a:2',3'-c]phenazine?

The melting point is 254-255°C.

What is the predicted density of Dipyrido[3,2-a:2',3'-c]phenazine?

The predicted density is 1.420±0.06 g/cm3.

What is the predicted pKa value of Dipyrido[3,2-a:2',3'-c]phenazine?

The predicted pKa value is -2.39±0.40.

What is the predicted boiling point of Dipyrido[3,2-a:2',3'-c]phenazine?

The predicted boiling point is 573.9±20.0 °C.

What is the recommended storage temperature for Dipyrido[3,2-a:2',3'-c]phenazine?

The recommended storage temperature is 2-8°C.

What is the HS Code for Dipyrido[3,2-a:2',3'-c]phenazine?

The HS Code is 2933998090.