ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

2-(Diphenylphosphino)benzenesulfonic acid

Catalog Number ACM111864256
CAS 111864-25-6
Synonyms Diphenylphosphinobenzene Sulfonic Acid
IUPAC Name 2-diphenylphosphanylbenzenesulfonic acid
Molecular Weight 342.35
Molecular Formula C18H15O3PS
InChI HXVJDHROZFWXHT-UHFFFAOYSA-N
InChI Key InChI=1S/C18H15O3PS/c19-23(20,21)18-14-8-7-13-17(18)22(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14H,(H,19,20,21)
Melting Point 255-260 °C
Purity 98%
Appearance Solid
Isomeric SMILES C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3S(=O)(=O)O
Q&A

What is the Monoisotopic Mass of the compound "2-(Diphenylphosphino)benzenesulfonic acid"?

342.04795251

What is the InChIKey of the compound "2-(Diphenylphosphino)benzenesulfonic acid"?

HXVJDHROZFWXHT-UHFFFAOYSA-N

What is the CAS number of the compound "2-(Diphenylphosphino)benzenesulfonic acid"?

111864-25-6

What are the computed properties of the compound "2-(Diphenylphosphino)benzenesulfonic acid"?

Complexity: 443; Covalently-Bonded Unit Count: 1; Defined Atom Stereocenter Count: 0; Defined Bond Stereocenter Count: 0; Formal Charge: 0; Heavy Atom Count: 23; Hydrogen Bond Acceptor Count: 3; Hydrogen Bond Donor Count: 1; Isotope Atom Count: 0; Rotatable Bond Count: 4; Topological Polar Surface Area: 62.8; Undefined Atom Stereocenter Count: 0; Undefined Bond Stereocenter Count: 0; XLogP3: 3.4

What are some of the depositor-supplied synonyms for the compound "2-(Diphenylphosphino)benzenesulfonic acid"?

2-diphenylphosphanylbenzenesulfonic acid; 2-Sulfophenyldiphenylphosphine; Diphenylphosphinobenzene sulfonic acid

What is the IUPAC name of the compound "2-(Diphenylphosphino)benzenesulfonic acid"?

2-diphenylphosphanylbenzenesulfonic acid

What is the molecular formula of the compound "2-(Diphenylphosphino)benzenesulfonic acid"?

C18H15O3PS

What is the molecular weight of the compound "2-(Diphenylphosphino)benzenesulfonic acid"?

342.3g/mol

Please kindly note that our products and services are for research use only.