ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Diphenyl(pyren-1-yl)phosphine

Catalog Number ACM110231306-1
CAS 110231-30-6
Structure {[CurrentData.Name]}
Synonyms 1-(Diphenylphosphino)pyrene; DPPP
IUPAC Name diphenyl(pyren-1-yl)phosphane
Molecular Weight 386.42
Molecular Formula C28H19P
InChI DSYGKYCYNVHCNQ-UHFFFAOYSA-N
InChI Key InChI=1S/C28H19P/c1-3-10-23(11-4-1)29(24-12-5-2-6-13-24)26-19-17-22-15-14-20-8-7-9-21-16-18-25(26)28(22)27(20)21/h1-19H
Boiling Point 627.9±55.0 °C(Predicted)
Melting Point 99-104 °C
Purity 95%
Appearance Solid
Isomeric SMILES C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=C4C=CC5=CC=CC6=C5C4=C(C=C6)C=C3
pKa 7.20±0.40(Predicted)
Q&A

What is the CAS number of Diphenyl(pyren-1-yl)phosphine?

The CAS number of Diphenyl(pyren-1-yl)phosphine is 110231-30-6.

What is the molecular formula of Diphenyl(pyren-1-yl)phosphine?

The molecular formula of Diphenyl(pyren-1-yl)phosphine is C28H19P.

What is the molecular weight of Diphenyl(pyren-1-yl)phosphine?

The molecular weight of Diphenyl(pyren-1-yl)phosphine is 386.4 g/mol.

What is the exact mass of Diphenyl(pyren-1-yl)phosphine?

The exact mass of Diphenyl(pyren-1-yl)phosphine is 386.122437604.

What is the InChIKey of Diphenyl(pyren-1-yl)phosphine?

The InChIKey of Diphenyl(pyren-1-yl)phosphine is DSYGKYCYNVHCNQ-UHFFFAOYSA-N.

How many heavy atoms are present in Diphenyl(pyren-1-yl)phosphine?

There are 29 heavy atoms present in Diphenyl(pyren-1-yl)phosphine.

What is the Computed Properties XLogP3 value for Diphenyl(pyren-1-yl)phosphine?

The Computed Properties XLogP3 value for Diphenyl(pyren-1-yl)phosphine is 7.7.

What are some of the Depositor-Supplied Synonyms for Diphenyl(pyren-1-yl)phosphine?

Some Depositor-Supplied Synonyms for Diphenyl(pyren-1-yl)phosphine include DPP-P, diphenylpyrenylphosphine, and 1-(Diphenylphosphino)pyrene.

How many Rotatable Bond Counts are there in Diphenyl(pyren-1-yl)phosphine?

There are 3 Rotatable Bond Counts in Diphenyl(pyren-1-yl)phosphine.

What is the complexity value for Diphenyl(pyren-1-yl)phosphine?

The complexity value for Diphenyl(pyren-1-yl)phosphine is 527.

Please kindly note that our products and services are for research use only.