(Dimethylphenylphosphine)gold chloride

Catalog Number	ACM28978098-1
CAS	28978-09-8
Structure
Synonyms	Chloro(dimethylphenylphosphine)gold
Molecular Weight	370.56
Molecular Formula	C8H11AuClP
Canonical SMILES	CP(C)C1=CC=CC=C1.Cl[Au]
InChI	InChI=1S/C8H11P.Au.ClH/c1-9(2)8-6-4-3-5-7-8;/h3-7H,1-2H3;1H/q;+1;/p-1
InChI Key	JUNOUWMLMVXRDI-UHFFFAOYSA-M
Melting Point	98-102 °C
Purity	97%
Exact Mass	369.99526
Hydrogen Bond Acceptor Count	0
Hydrogen Bond Donor Count	0
Monoisotopic Mass	369.99526
Rotatable Bond Count	1
Topological Polar Surface Area	0 Ų

Q&A

What is the full chemical name of the product?

The full chemical name of the product is (Dimethylphenylphosphine)gold chloride.

What is the molecular weight of the product?

The molecular weight of the product is 371.57 g/mol.

What are the product categories that the product falls under?

The product falls under the category of Au.

What are some synonyms for the product?

Some synonyms for the product include Chloro(dimethylphenylphosphine)gold and (DiMethylphenylphosphine)gold chloride.

What is the molecular formula of the product?

The molecular formula of the product is C8H12AuClP.

What is the melting point of the product?

The melting point of the product is 98-102°C.

What hazard codes are associated with the product?

The hazard code Xi is associated with the product.

What safety statements are recommended for handling the product?

Safety statements 26-36/37 are recommended for handling the product.

What risk statements are associated with the product?

Risk statements 36/37/38 are associated with the product.

What is the Water German Classification (WGK) of the product?

The WGK Germany classification of the product is 3.