9,9-Dimethylcarbazine

Catalog Number	ACM6267023-3
CAS	6267-02-3
Structure
Synonyms	9,9-Dimethyl-9,10-dihydroacridine
IUPAC Name	9,9-dimethyl-10H-acridine
Molecular Weight	209.29
Molecular Formula	C15H15N
Canonical SMILES	CC1(C2=CC=CC=C2NC3=CC=CC=C31)C
InChI	JSEQNGYLWKBMJI-UHFFFAOYSA-N
InChI Key	InChI=1S/C15H15N/c1-15(2)11-7-3-5-9-13(11)16-14-10-6-4-8-12(14)15/h3-10,16H,1-2H3
Boiling Point	120 - 126 °C
Melting Point	120-126 °C
Purity	98%
Density	1.043 ± 0.06 g/ml
Appearance	Solid
Isomeric SMILES	CC1(C2=CC=CC=C2NC3=CC=CC=C31)C

Q&A

What is the molecular weight of 9,9-dimethylcarbazine?

The molecular weight of 9,9-dimethylcarbazine is 209.29.

What are some synonyms for 9,9-dimethylcarbazine?

Some synonyms for 9,9-dimethylcarbazine are 9,10-dihydro-9,9-dimethyl-acridin, 9,9-Dimethylacridan, NSC 36671, and BLE.

What is the melting point of 9,9-dimethylcarbazine?

The melting point of 9,9-dimethylcarbazine is 120-126℃.

What is the density of 9,9-dimethylcarbazine?

The predicted density of 9,9-dimethylcarbazine is 1.043±0.06 g/cm3.

In what solvents is 9,9-dimethylcarbazine slightly soluble?

9,9-dimethylcarbazine is slightly soluble in chloroform and methanol.

What is the predicted pka of 9,9-dimethylcarbazine?

The predicted pka of 9,9-dimethylcarbazine is 2.05±0.40.

What is the Boiling point of 9,9-dimethylcarbazine?

The boiling point of 9,9-dimethylcarbazine is 155°C/1mmHg.

How should 9,9-dimethylcarbazine be stored?

9,9-dimethylcarbazine should be kept in a dark place, sealed in dry, at room temperature.

What is the form of 9,9-dimethylcarbazine?

9,9-dimethylcarbazine can be in the form of powder to crystal.

What are some uses of 9,9-dimethylcarbazine?

9,9-Dimethyl-9,10-dihydroacridine is being used in the development of TADF molecules for their efficient deep-blue emitting potential.