Dimethyl 1,1'-ferrocenedicarboxylate

Catalog Number	ACM1273956
CAS	1273-95-6
Synonyms	Ferrocene-1,1'-dicarboxylic acid dimethylester
Molecular Weight	302.1
Molecular Formula	C14H14FeO4
Canonical SMILES	COC(=O)[C-]1[CH-][CH-][CH-][CH-]1.COC(=O)[C-]1C=CC=C1.[Fe]
InChI	InChI=1S/2C7H7O2.Fe/c2*1-9-7(8)6-4-2-3-5-6;/h2*2-5H,1H3;/q-5;-1;
InChI Key	UZCQZDWWLBPSAF-UHFFFAOYSA-N
Melting Point	112-113 °C
Purity	98%
Complexity	300
Covalently-Bonded Unit Count	3
Defined Atom Stereocenter Count	0
Exact Mass	302.024144
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	10
Hydrogen Bond Donor Count	0
Monoisotopic Mass	302.024144
Rotatable Bond Count	4
Topological Polar Surface Area	52.6 Ų

Q&A

What is the CAS number for dimethyl 1,1'-ferrocenedicarboxylate?

The CAS number for dimethyl 1,1'-ferrocenedicarboxylate is 1273-95-6.

What is the molecular weight of dimethyl 1,1'-ferrocenedicarboxylate?

The molecular weight of dimethyl 1,1'-ferrocenedicarboxylate is 294.04.

What are some synonyms for dimethyl 1,1'-ferrocenedicarboxylate?

Some synonyms for dimethyl 1,1'-ferrocenedicarboxylate include Ferrocene-1,1'-dicarboxylic acid dimethyl ester, Ferrocene,1,1'-bis(methoxycarbonyl)-, and Dimethyl 1,1'-ferrocenedicarboxylate.

What is the chemical formula of dimethyl 1,1'-ferrocenedicarboxylate?

The chemical formula of dimethyl 1,1'-ferrocenedicarboxylate is C14H6FeO4.

What is the melting point of dimethyl 1,1'-ferrocenedicarboxylate?

The melting point of dimethyl 1,1'-ferrocenedicarboxylate is 112-113 °C.

How should dimethyl 1,1'-ferrocenedicarboxylate be stored?

Dimethyl 1,1'-ferrocenedicarboxylate should be stored in an inert atmosphere at room temperature.

What is the density of dimethyl 1,1'-ferrocenedicarboxylate?

The density of dimethyl 1,1'-ferrocenedicarboxylate is 1.589 g/cm3.

Is dimethyl 1,1'-ferrocenedicarboxylate soluble in water?

Based on the information provided, it is not clear whether dimethyl 1,1'-ferrocenedicarboxylate is soluble in water.