2-(2,4-Difluorophenyl)-5-fluoropyridine

Catalog Number	ACM1426047019-1
CAS	1426047-01-9
Synonyms	Pyridine, 2-(2,4-difluorophenyl)-5-fluoro-
IUPAC Name	2-(2,4-difluorophenyl)-5-fluoropyridine
Molecular Weight	209.17
Molecular Formula	C11H6F3N
Canonical SMILES	C1=CC(=C(C=C1F)F)C2=NC=C(C=C2)F;
InChI	RKUQBAQVAGDVEX-UHFFFAOYSA-N
InChI Key	InChI=1S/C11H6F3N/c12-7-1-3-9(10(14)5-7)11-4-2-8(13)6-15-11/h1-6H
Boiling Point	240.5±35.0 °C(Predicted)
Melting Point	75-78 °C
Purity	98%
Appearance	Powder
Complexity	212
Covalently-Bonded Unit Count	1
Exact Mass	209.045g/mol
Heavy Atom Count	15
Isomeric SMILES	C1=CC(=C(C=C1F)F)C2=NC=C(C=C2)F
Monoisotopic Mass	209.045g/mol
Rotatable Bond Count	1
Topological Polar Surface Area	12.9A^2

Q&A

What is the molecular weight of 2-(2,4-difluorophenyl)-5-fluoropyridine?

The molecular weight is 209.17.

What is the product name of CAS:1426047-01-9?

The product name is Pyridine, 2-(2,4-difluorophenyl)-5-fluoro-.

What are the synonyms for 2-(2,4-Difluorophenyl)-5-fluoropyridine?

The synonyms are Pyridine, 2-(2,4-difluorophenyl)-5-fluoro- and 2-(2,4-Difluorophenyl)-5-fluoropyridine.

What is the chemical formula of the compound?

The chemical formula is C11H6F3N.

What is the predicted boiling point of 2-(2,4-difluorophenyl)-5-fluoropyridine?

The predicted boiling point is 240.5±35.0 °C.

What is the predicted pka value of the compound?

The predicted pka value is 1.49±0.27.

What is the predicted density of the compound?

The predicted density is 1.302±0.06 g/cm3.

What are the uses of this ligand?

This ligand is used in Ir(III) complexes suitable for use in photocatalysis and phosphorescent OLEDs.

What percentage purity is specified for 2-(2,4-Difluorophenyl)-5-fluoropyridine?

The compound is specified to have a minimum purity of 95%.

In what types of applications is Pyridine, 2-(2,4-difluorophenyl)-5-fluoro- commonly used?

It is commonly used in photocatalysis and phosphorescent OLEDs.