Diethylphosphoramidous dichloride

Catalog Number	ACM1069085-1
CAS	1069-08-5
Structure
Synonyms	Dichloro(diethylamino)phosphine; N-Dichlorophosphanyl-N-ethylethanamine;
IUPAC Name	N-dichlorophosphanyl-N-ethylethanamine
Molecular Weight	174.01
Molecular Formula	C4H10Cl2NP
InChI	BPEMCEULJQTJMI-UHFFFAOYSA-N
InChI Key	InChI=1S/C4H10Cl2NP/c1-3-7(4-2)8(5)6/h3-4H2,1-2H3
Boiling Point	179 °C (lit.)
Flash Point	181 °F
Purity	97%
Density	1.196 g/mL at 25 °C (lit.)
Appearance	Liquid
Isomeric SMILES	CCN(CC)P(Cl)Cl
pKa	-1.49±0.70(Predicted)

Q&A

What is the IUPAC name of Diethylphosphoramidous dichloride?

The IUPAC name is N-dichlorophosphanyl-N-ethylethanamine.

What is the molecular formula of Diethylphosphoramidous dichloride?

The molecular formula is C4H10Cl2NP.

What is the molecular weight of Diethylphosphoramidous dichloride?

The molecular weight is 174.01 g/mol.

What is the exact mass of Diethylphosphoramidous dichloride?

The exact mass is 172.9927917.

How many heavy atoms are present in Diethylphosphoramidous dichloride?

There are 8 heavy atoms present.

How many rotatable bonds are present in Diethylphosphoramidous dichloride?

There are 2 rotatable bonds present.

Is Diethylphosphoramidous dichloride a hydrogen bond acceptor or donor?

It is a hydrogen bond acceptor with a count of 1.

What is the Canonical SMILES representation of Diethylphosphoramidous dichloride?

The Canonical SMILES representation is CCN(CC)P(Cl)Cl.

What is the CAS number of Diethylphosphoramidous dichloride?

The CAS number is 1069-08-5.

What are some of the synonyms for Diethylphosphoramidous dichloride listed?

Some synonyms include Dichloro(diethylamino)phosphine, Et2NPCl2, and Diethylaminodichlorophosphine.