ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

Diethylphosphoramidous dichloride

Catalog Number ACM1069085-1
CAS 1069-08-5
Structure {[CurrentData.Name]}
Synonyms Dichloro(diethylamino)phosphine; N-Dichlorophosphanyl-N-ethylethanamine;
IUPAC Name N-dichlorophosphanyl-N-ethylethanamine
Molecular Weight 174.01
Molecular Formula C4H10Cl2NP
InChI BPEMCEULJQTJMI-UHFFFAOYSA-N
InChI Key InChI=1S/C4H10Cl2NP/c1-3-7(4-2)8(5)6/h3-4H2,1-2H3
Boiling Point 179 °C (lit.)
Flash Point 181 °F
Purity 97%
Density 1.196 g/mL at 25 °C (lit.)
Appearance Liquid
Isomeric SMILES CCN(CC)P(Cl)Cl
pKa -1.49±0.70(Predicted)
Q&A

What is the IUPAC name of Diethylphosphoramidous dichloride?

The IUPAC name is N-dichlorophosphanyl-N-ethylethanamine.

What is the molecular formula of Diethylphosphoramidous dichloride?

The molecular formula is C4H10Cl2NP.

What is the molecular weight of Diethylphosphoramidous dichloride?

The molecular weight is 174.01 g/mol.

What is the exact mass of Diethylphosphoramidous dichloride?

The exact mass is 172.9927917.

How many heavy atoms are present in Diethylphosphoramidous dichloride?

There are 8 heavy atoms present.

How many rotatable bonds are present in Diethylphosphoramidous dichloride?

There are 2 rotatable bonds present.

Is Diethylphosphoramidous dichloride a hydrogen bond acceptor or donor?

It is a hydrogen bond acceptor with a count of 1.

What is the Canonical SMILES representation of Diethylphosphoramidous dichloride?

The Canonical SMILES representation is CCN(CC)P(Cl)Cl.

What is the CAS number of Diethylphosphoramidous dichloride?

The CAS number is 1069-08-5.

What are some of the synonyms for Diethylphosphoramidous dichloride listed?

Some synonyms include Dichloro(diethylamino)phosphine, Et2NPCl2, and Diethylaminodichlorophosphine.

Please kindly note that our products and services are for research use only.