Diethylphosphine oxide

Catalog Number	ACM7215330-1
CAS	7215-33-0
Structure
Synonyms	Diethyl phosphine oxide; Phosphine oxide, diethyl-
IUPAC Name	diethyl(oxo)phosphanium
Molecular Weight	105.10
Molecular Formula	C4H10OP+
Canonical SMILES	CC[P+](=O)CC
InChI	YVXVNGVYXSQARS-UHFFFAOYSA-N
InChI Key	InChI=1S/C4H10OP/c1-3-6(5)4-2/h3-4H2,1-2H3/q+1
Boiling Point	52-53 °C(Press: 1.5 Torr)
Purity	97%
Density	0.9698 g/cm3
Appearance	Solid
Exact Mass	106.05500
Isomeric SMILES	CC[P+](=O)CC

Q&A

What is the CAS number for Diethylphosphine oxide?

The CAS number for Diethylphosphine oxide is 55039-16-2.

What is the Canonical SMILES notation for Diethylphosphine oxide?

The Canonical SMILES notation for Diethylphosphine oxide is CCP(=O)(CC)C1=CC=CC(=C1)N.

How many hydrogen bond acceptors are present in Diethylphosphine oxide?

There are 2 hydrogen bond acceptors present in Diethylphosphine oxide.

What is the exact mass of Diethylphosphine oxide?

The exact mass of Diethylphosphine oxide is 197.096951132.

What is the molecular weight of Diethylphosphine oxide?

The molecular weight of Diethylphosphine oxide is 197.21g/mol.

What is the IUPAC name of Diethylphosphine oxide?

The IUPAC name of Diethylphosphine oxide is 3-diethylphosphorylaniline.

How many heavy atoms are present in Diethylphosphine oxide?

There are 13 heavy atoms present in Diethylphosphine oxide.

What is the InChIKey for Diethylphosphine oxide?

The InChIKey for Diethylphosphine oxide is CTRVJASKVTVHKB-UHFFFAOYSA-N.

What are some depositor-supplied synonyms for Diethylphosphine oxide?

Some depositor-supplied synonyms for Diethylphosphine oxide are 3-(diethylphosphoryl)aniline, MLS000080942, CHEMBL1609113, and (3-Aminophenyl)diethylphosphine oxide.

What is the topological polar surface area of Diethylphosphine oxide?

The topological polar surface area of Diethylphosphine oxide is 43.1.