Diethyl chlorophosphite

Catalog Number	ACM589571-1
CAS	589-57-1
Structure
Synonyms	Diethyl phosphorochloridite; Ethyl phosphorochloridite; Phosphorochloridous acid, diethyl ester
IUPAC Name	chloro(diethoxy)phosphane
Molecular Weight	156.54
Molecular Formula	C4H10ClO2P
InChI	TXHWYSOQHNMOOU-UHFFFAOYSA-N
InChI Key	InChI=1S/C4H10ClO2P/c1-3-6-8(5)7-4-2/h3-4H2,1-2H3
Boiling Point	153-155 °C(lit.)
Melting Point	25 °C
Flash Point	34 °F
Purity	97%
Density	1.089 g/mL at 20 °C (lit.)
Appearance	Liquid
Isomeric SMILES	CCOP(OCC)Cl

Q&A

What is the CAS number for Diethyl chlorophosphite?

The CAS number for Diethyl chlorophosphite is 589-57-1.

What is the molecular formula of Diethyl chlorophosphite?

The molecular formula of Diethyl chlorophosphite is C4H10ClO2P.

How many hydrogen bond acceptors does Diethyl chlorophosphite have?

Diethyl chlorophosphite has 2 hydrogen bond acceptors.

What is the exact mass of Diethyl chlorophosphite?

The exact mass of Diethyl chlorophosphite is 156.0106942 g/mol.

What is the Computed Properties XLogP3 value for Diethyl chlorophosphite?

The Computed Properties XLogP3 value for Diethyl chlorophosphite is 1.5.

What are some other names for Diethyl chlorophosphite as listed in the Depositor-Supplied Synonyms?

Some other names for Diethyl chlorophosphite include Ethyl phosphorochloridite, Diethyl phosphorochloridite, and Ethyl chlorophosphite.

What is the Canonical SMILES for Diethyl chlorophosphite?

The Canonical SMILES for Diethyl chlorophosphite is CCOP(OCC)Cl.

What is the molecular weight of Diethyl chlorophosphite?

The molecular weight of Diethyl chlorophosphite is 156.55 g/mol.

How many rotatable bonds does Diethyl chlorophosphite have?

Diethyl chlorophosphite has 4 rotatable bonds.

What is the InChIKey for Diethyl chlorophosphite?

The InChIKey for Diethyl chlorophosphite is TXHWYSOQHNMOOU-UHFFFAOYSA-N.