What is the CAS number for Dicyclohexyl(9-benzylfluoren-9-yl)phosphonium tetrafluoroborate?
The CAS number for Dicyclohexyl(9-benzylfluoren-9-yl)phosphonium tetrafluoroborate is 937378-18-2.
How many heavy atoms are present in the molecule?
There are 38 heavy atoms present in the molecule.
What is the molecular weight of Dicyclohexyl(9-benzylfluoren-9-yl)phosphonium tetrafluoroborate?
The molecular weight of Dicyclohexyl(9-benzylfluoren-9-yl)phosphonium tetrafluoroborate is 540.4 g/mol.
How many rotatable bonds are present in the molecule?
There are 5 rotatable bonds present in the molecule.
What is the IUPAC name of Dicyclohexyl(9-benzylfluoren-9-yl)phosphonium tetrafluoroborate?
The IUPAC name of Dicyclohexyl(9-benzylfluoren-9-yl)phosphonium tetrafluoroborate is (9-benzylfluoren-9-yl)-dicyclohexylphosphanium;tetrafluoroborate.
How many hydrogen bond acceptors are present in the molecule?
There are 5 hydrogen bond acceptors present in the molecule.
What is the exact mass of Dicyclohexyl(9-benzylfluoren-9-yl)phosphonium tetrafluoroborate?
The exact mass of Dicyclohexyl(9-benzylfluoren-9-yl)phosphonium tetrafluoroborate is 540.2740310.
What is the Canonical SMILES representation of the molecule?
[B-](F)(F)(F)F.C1CCC(CC1)[PH+](C2CCCCC2)C3(C4=CC=CC=C4C5=CC=CC=C53)CC6=CC=CC=C6
How many covalently-bonded units are there in the structure?
There are 2 covalently-bonded units in the structure.
What is the Monoisotopic Mass of Dicyclohexyl(9-benzylfluoren-9-yl)phosphonium tetrafluoroborate?
The Monoisotopic Mass of Dicyclohexyl(9-benzylfluoren-9-yl)phosphonium tetrafluoroborate is 540.2740310.