Dicyclohexyl(2-tolyl)phosphine

Catalog Number	ACM173593254-1
CAS	173593-25-4
Structure
Synonyms	Dicyclohexyl(2-Methylphenyl)Phosphine
IUPAC Name	dicyclohexyl-(2-methylphenyl)phosphane
Molecular Weight	288.41
Molecular Formula	C19H29P
InChI	MKHYBAIPMJGEQO-UHFFFAOYSA-N
InChI Key	InChI=1S/C19H29P/c1-16-10-8-9-15-19(16)20(17-11-4-2-5-12-17)18-13-6-3-7-14-18/h8-10,15,17-18H,2-7,11-14H2,1H3
Boiling Point	409.1±24.0 °C(Predicted)
Melting Point	90-93 °C
Purity	98%
Appearance	Solid
Isomeric SMILES	CC1=CC=CC=C1P(C2CCCCC2)C3CCCCC3

Q&A

What is the CAS number of Dicyclohexyl(2-tolyl)phosphine?

The CAS number of Dicyclohexyl(2-tolyl)phosphine is 173593-25-4.

What are some synonyms for Dicyclohexyl(2-tolyl)phosphine?

Some synonyms for Dicyclohexyl(2-tolyl)phosphine are Dicyclohexyl(o-tolyl)phosphine, Dicyclohexyl(2-methylphenyl)phosphine, and Dicyclohexyl(2-tolyl)phosphine.

What is the molecular formula of Dicyclohexyl(2-tolyl)phosphine?

The molecular formula of Dicyclohexyl(2-tolyl)phosphine is C19H29P.

What is the molecular weight of Dicyclohexyl(2-tolyl)phosphine?

The molecular weight of Dicyclohexyl(2-tolyl)phosphine is 288.4g/mol.

What is the Canonical SMILES representation of Dicyclohexyl(2-tolyl)phosphine?

The Canonical SMILES representation of Dicyclohexyl(2-tolyl)phosphine is CC1=CC=CC=C1P(C2CCCCC2)C3CCCCC3.

How many heavy atoms does Dicyclohexyl(2-tolyl)phosphine contain?

Dicyclohexyl(2-tolyl)phosphine contains 20 heavy atoms.

What is the XLogP3 value of Dicyclohexyl(2-tolyl)phosphine?

The XLogP3 value of Dicyclohexyl(2-tolyl)phosphine is 5.5.

What is the formal charge of Dicyclohexyl(2-tolyl)phosphine?

The formal charge of Dicyclohexyl(2-tolyl)phosphine is 0.

How many rotatable bonds does Dicyclohexyl(2-tolyl)phosphine have?

Dicyclohexyl(2-tolyl)phosphine has 3 rotatable bonds.

What is the InChIKey of Dicyclohexyl(2-tolyl)phosphine?

The InChIKey of Dicyclohexyl(2-tolyl)phosphine is MKHYBAIPMJGEQO-UHFFFAOYSA-N.