What is the molecular formula of dicyclohexyl(2',4',6'-tri-tert-butyl-[1,1'-biphenyl]-2-yl)phosphine?
The molecular formula is C36H55P.
What is the exact mass of dicyclohexyl(2',4',6'-tri-tert-butyl-[1,1'-biphenyl]-2-yl)phosphine?
The exact mass is 518.40413875 g/mol.
What is the IUPAC name of the compound?
The IUPAC name is dicyclohexyl-[2-(2,4,6-tritert-butylphenyl)phenyl]phosphane.
How many heavy atoms are present in the compound?
There are 37 heavy atoms present.
What is the Canonical SMILES of the compound?
CC(C)(C)C1=CC(=C(C(=C1)C(C)(C)C)C2=CC=CC=C2P(C3CCCCC3)C4CCCCC4)C(C)(C)C
What is the Computed Properties XLogP3 value?
The XLogP3 value is 11.8.
What is the InChI of the compound?
InChI=1S/C36H55P/c1-34(2,3)26-24-30(35(4,5)6)33(31(25-26)36(7,8)9)29-22-16-17-23-32(29)37(27-18-12-10-13-19-27)28-20-14-11-15-21-28/h16-17,22-25,27-28H,10-15,18-21H2,1-9H3
What is the InChIKey of the compound?
KLQXTSWJFQDLAL-UHFFFAOYSA-N
How many rotatable bonds are present in the compound?
There are 7 rotatable bonds present.
What is the depositor-supplied synonym for the compound?
The depositor-supplied synonym is 2-(dicyclohexylphosphino)-2',4',6'-tri-tert-butyl-1,1'-biphenyl.