ligands&coordination complexes / Alfa Chemistry
Banner
Online Inquiry
Verification code

1,3-Dicyclohexyl-1H-benzo[d]imidazol-3-ium chloride

Catalog Number ACM1034449154-1
CAS 1034449-15-4
Synonyms 1,3-Dicyclohexylbenzimidazolium chloride
IUPAC Name 1,3-dicyclohexylbenzimidazol-3-ium;chloride
Molecular Weight 318.88
Molecular Formula C19H27ClN2
InChI JACUDTKAZHCIPU-UHFFFAOYSA-M
InChI Key InChI=1S/C19H27N2.ClH/c1-3-9-16(10-4-1)20-15-21(17-11-5-2-6-12-17)19-14-8-7-13-18(19)20;/h7-8,13-17H,1-6,9-12H2;1H/q+1;/p-1
Melting Point 216-220 °C
Purity 98%
Appearance Solid
Isomeric SMILES C1CCC(CC1)N2C=[N+](C3=CC=CC=C32)C4CCCCC4.[Cl-]
Q&A

What is the molecular weight of 1,3-Dicyclohexyl-1H-benzo[d]imidazol-3-ium chloride?

The molecular weight is 318.89.

What are the product categories that 1,3-Dicyclohexyl-1H-benzo[d]imidazol-3-ium chloride belongs to?

Achiral Nitrogen; NHC.

What is the minimum purity percentage of the product "1,3-Dicyclohexylbenzimidazolium chloride"?

The minimum purity is 97%.

What is another name for 1,3-Dicyclohexyl-1H-benzo[d]imidazol-3-ium chloride?

1,3-Dicyclohexylbenzimidazolium chloride, 1,3-DICYCLOHEXYLBENZIMIDAZOLIUMCHLORIDE, 1,3-Dicyclohexylbenzimidazol-3-ium chloride, 3-Dicyclohexylbenzimidazolium chloride.

What is the melting point range of 1,3-Dicyclohexyl-1H-benzo[d]imidazol-3-ium chloride?

The melting point range is 216-220°C.

In what form is 1,3-Dicyclohexyl-1H-benzo[d]imidazol-3-ium chloride typically found?

Powder form.

How should 1,3-Dicyclohexyl-1H-benzo[d]imidazol-3-ium chloride be stored?

It should be stored under inert gas (nitrogen or Argon) at 2-8°C.

What is the color of 1,3-Dicyclohexyl-1H-benzo[d]imidazol-3-ium chloride?

White to gray to tan.

What is the HS Code for 1,3-Dicyclohexyl-1H-benzo[d]imidazol-3-ium chloride?

The HS Code is 2933998090.

What are some of the uses of 1,3-Dicyclohexyl-1H-benzo[d]imidazol-3-ium chloride?

It is used as a catalyst in rhodium-N-heterocyclic carbene complex-catalyzed O-arylation of phenols with arylbromides and as a reactant in the preparation of Pd-PEPPSI complexes for catalysis of cross-coupling reactions.

Please kindly note that our products and services are for research use only.